II. Name the following fatty acids by the symbol (C:B) 1. 2. 3. HO НО. НО.
Q: Which of these antibody based molecules is used as a hybrid drug for cancer treatment? O…
A: Antibodies were first described as a neutralizing substance found in blood. Antibodies were…
Q: 16. Please name the Glycosidic bond of the following disaccharides
A: A glycosidic bond is a covalent bond that links a carbohydrate molecule to another group, which may…
Q: Opiate drugs bind to receptors in the brain for: Group of answer choices endorphins.…
A: Opiate drugs, including substances like morphine and heroin, play a significant role in medication…
Q: Why is there no peak in the region between 2300-2310 cm-1?
A: The question is asking why there is no peak in the infrared (IR) spectrum in the region between…
Q: Which of the following regarding DNA replication is FALSE. Replication of DNA is highly regulated.…
A: There are four classes of biological macromolecules: Nucleic acids, proteins, lipids and…
Q: isoprenoid precursors
A: Question A asks which isoprenoid precursor, IPP or DMAPP, is more susceptible to SN1 reaction. DMAPP…
Q: Enter the product of this Schiff base formation reaction: OH OH OPO3²- OH where R. represents…
A: Schiff bases are compunds with a double bond between a carbon and a nitrogen atom.
Q: The HIV virus attacks the human immune system causing extensive damage. This virus contains several…
A: Proteins are three-dimensional polymers of amino acid residues linked together via peptide bonds.…
Q: Not hand written and no answer from Chat GPT please
A: The pyruvate dehydrogenase (PDH) complex is a huge multi enzyme complex that plays a pivotal part in…
Q: 애 애
A: Amino acids are the building blocks of protein. They are connected by peptide bonds. Each protein…
Q: The formation of acetyl-CoA from acetate is an ATP-driven reaction: Acetate + ATP + CoA Acetyl CoA +…
A: A reaction with a negative Delta G value is thermodynamically favorable and occurs spontaneously.The…
Q: The major control enzyme in glycolysis is: a) hexokinase b) phosphofructokinase c) aldolase…
A: The objective of these questions is to test the understanding of the glycolysis process, which is a…
Q: 1. pH Effects a. In the enzyme mechanism of lysozyme, two acidic amino acid residues, Asp52 and…
A: The pKa value of amino acid signifies how easily that amino acid loses a proton. The lower the pKa…
Q: Select the AA residues that are lipid-facing, according to the figure below. a N15 L21 D S16 V25 L18…
A: Hydrophobic or Hydrophilic nature of amino acidHydrophilic or hydrophobic nature is imparted by…
Q: The steps to convert chaulmoogra oil into an injectable treatment are: 1. extraction II.…
A: The chaulmoorga oil was used to treat leprosy. In earlier times the extracted seed oil was directly…
Q: Discuss the effect of EDTA on ca absorbance in AAS experiment
A: EDTA stands for Ethylenediaminetetraacetic acid, is a type of anticoagulant which prevents the blood…
Q: How is it possible to determine the structure of an enzyme substrate complex by x ray…
A: The objective of the question is to understand how the structure of an enzyme-substrate complex can…
Q: Which of the following events would have the strongest influence on the overall three-dimensional…
A: Proteins are complex molecules containing large number of amino acids present all living organisms.
Q: A patient has a defective liver FBPase-2 enzyme, the enzyme that converts F2,6P into F6P. This…
A: Fructose 2,6-BIsphosphate is a potent regulator of glycolysis and gluconeogenesis. It has a special…
Q: Wild-type Mutant 1 Mutant 2 Mutant 3 Stop silent DNA 3 CTT 5 5 3 5 Val missense 3CTC 5 5 GAG 3 mRNA…
A: The genetic code is the set of rules used by living cells to translate information encoded within…
Q: The diversity of functional groups on sugars that can form glycosidic bonds greatly increases the…
A: Peptides are the compounds formed from the amino acids.Amino acids are the building blocks of…
Q: **Please answer as soon as possible!!!** Can you check if the answer below is correct/has correct…
A: In glycolysis, a 6-carbon molecule of glucose-6-phosphate is broken down into 3-carbon pyruvate. It…
Q: The hormone which regulates pH in the intestine is called: a) cholecystokinin b) secretin c)…
A: The objective of the first question is to identify the hormone that regulates pH in the intestine.…
Q: In the following reaction, a molecule of ATP bound to the enzyme transfer a phosphate to fructose…
A: Correct Option: b. The change in the activation energy barrier is greater than 27.6…
Q: An inactive form of a digestive enzyme is called a: a) precursor b) zymogen c) proteozyme d)…
A: The first question is asking for the term used to describe an inactive form of a digestive enzyme.…
Q: 2. ( Labeling molecules with isotopes has long been used to trace and characterize metabolic…
A:
Q: Why does isolated DNA appear stringy?
A: DNA is also known by the name Deoxyribonucleic acid. It comprises of the genetic instructions that…
Q: A contributing factor to the development of arthritis is the inappropriate proteolytic destruction…
A: A variable is any quantity we can measure. In any experiment there are three variables: Independent:…
Q: The SGLT transporter may be best described as a: a) symporter b) antiporter c) pump protein d)…
A: The objective of these questions is to test the understanding of various biochemical processes and…
Q: What are the benefits of measuring the initial rate of a reaction V. for use in kinetic studies?…
A: Recall that the rate of a chemical reaction is dC/dt where dC is the change in the analyte…
Q: Question 3 (1 pt): Which positions in adenine and guanine have the potential to form hydrogen bonds…
A: There are four classes of biological macromolecules; nucleic acid, proteins, lipids and…
Q: A chemistry student accidentally spills chlorine bleach into a dilute acid. The mixture reacts and…
A: There are two biologically important buffer systems: the Carbonate Buffer System and the Phosphate…
Q: Explain how alternative splicing of mRNA coding for a receptor tyrosine kinase could lead to…
A: The receptor tyrosine kinases are cell surface receptors that can bind to ligands like polypeptide…
Q: What is the average radius of a piece of double-stranded DNA in water that has a link length of 3.9…
A: The persistence length (link length) of double stranded DNA is a measure of how stiff or flexible…
Q: Step 2 Part A: Where did the extra oxygen come from for the 12 oxygen required to make 4 molecules…
A: Glycolysis is the ten-step conversion of 1 molecule of glucose to 2 molecules of pyruvate. ATP and…
Q: A. Provide a reasonable mechanism for the production of geranyl pyrophosphate from IPP and DMAPP B.…
A: The pyrophosphate ester of the terpenoid geraniol is geranyl pyrophosphate (GPP), often referred to…
Q: The initial rate for an enzyme-catalyzed reaction has been determined at a number of substrate…
A: MM plot is Michaelis Menten plot which is constructed by taking Substrate concentration on X axis…
Q: Which of the following has a phosphoanhydride bond? Select all that apply. n A of of най OH OH о B Ш…
A: Phosphoanhydride bond: the bond that is formed by the removal of water molecules between two…
Q: The KM values for the reaction of chymotrypsin with two different substrates are given in the table…
A: Km, also called the Michaelis Menten's constant is a measure of the enzyme's affinity for the…
Q: II. While there are many different types of inhibitors, most have a very similar structure so they…
A: Enzymes are high molecular weight protein that catalyse biochemical reactions. They contain a active…
Q: An enzyme has a Km of 10 mM and a Vm of 100 mmol/min If [S]=10 mM, which will increase the velocity…
A: For a one-substrate enzyme catalyzed reaction, the Michaelis-Menton equation shows the quantitative…
Q: Which hypothesis best explains the results for these two inhibitors? O Ibuprofen and indomethacin…
A: Inhibitors can be broadly categorized into reversible and irreversible.Reversible inhibitors bind…
Q: Which of the following aspects of catalysis by enzymes can NOT be explained by the Fischer Lock and…
A: Enzymes are proteins that catalyze biochemical reactions. Enzymes catalyse the reaction by reducing…
Q: Electron transfer translocates protons from the mitochondrial matrix to the external medium,…
A: Oxidation of substrates such as glucose, citrate, pyruvate etc releases electrons that are carried…
Q: Calculate the reduction potential of cytochrome a3 (°' = 0.385 V) at 25.0°C when the Fe3+ form =…
A: Biological oxidation-reduction reactions involve the transfer of electrons from one biomolecule,…
Q: Moore's Test We did an experiment about carbohydrate chemistry and the professor did not elaborate…
A: Moore's test is used to detect the presence of reducing carbohydrates. Here, the sample is treated…
Q: Explain question 5. Show work how to do it
A: Combining glucose (1) and glucose (2) without differentiating the reducing end configurations, we…
Q: Describe why hydrogen, carbon, nitrogen, and oxygen can be considered the most important building…
A: A cell is the basic unit of life. Cells are made up of biomolecules like carbohydrate, proteins,…
Q: Construct and name the structure of a monoglyceride Two diglycerides (positions 1,2 and 1,3) and two…
A: Monoglycerides are composed of a glycerol molecule ester linked to one fatty acidDiglycerides are…
Q: You happen to pass a bar. Distracted by your entrance into the bar, one of the humans inadvertently…
A: Ethanol and methanol are both first metabolized by the same enzyme, alcohol dehydrogenase. The…
Step by step
Solved in 3 steps
- a.) identify each of the following as a saturated, monounsaturated, polyunsaturated, omega-3, or omega-6 fatty acid b.) write the shorthand notations for all the fatty acidsThe main fatty acid component of the triacylglycerols in coconut oil is lauric acid, CH3(CH,)10COOH. Explain why coconut oil is a liquid at room temperature despite the fact that it contains a large fraction of this saturated fatty acid. 2.common and short-hand notation Name the following Fatty Acids using their systematic, ACTIVITY 8.1.1 1. CH3(CH2)5CH=CH(CH2)7COOH 2. CH3(CH2)7CH=CH(CH2)7COOH 3. CH3(CH2)10COOH 4. CH3(CH2)16COOH 5. CH3CH2(CH=CHCH2)3(CH2)6COOH
- Consider the following fatty acids: (i) 16:0; (ii) 20:0 and (iii) 20:4 A5,8,11,14. Rank them according to their liquidity at room temperature starting from the lowest to highest. O (ii) , (ii) , (1) O (ii) , (i) , (ii) O (1), (ii), (i) O (ii) , (1), (ii)The structural formula of which vitamin is shown. Write the main functions of this vitamin, what enzymes or what chemical reactions it catalyzes? What are the main foods that contain this vitamin, or describe how this vitamin is being synthetized in a body? Associated diseases. 1. 2. HC- 3. CH, CH-CH-CH-CH.)M CH CH, HO CH, CH,Describe the four functional groups of carbon 2 based on a typical saturated fatty acid.
- 1. a. How will you classify Lipids? Differentiate the Simple, Compound and Derived lipids. b. Write down the details about structure and functions of fatty acids.Which of the following fatty acids is oleic acid (18:1, cis A9) Bg) (CH3)₂ - CH₂ -CH-COOH + CH₂-CH-COOH -H₂O NH₂ OH NH₂ 4. Write the equation for the digestion (hydrolysis) of Phe-Asp-Ala. €
- List the classification of fatty acids based on their chemical structures, as well as their synthesis and acquisition from natural food sources. Discuss how they are classified in this manner.Butter can become rancid as a result of hydrolysis by microorganism. Which of the fatty acids are responsible for the bad odor associated with rancidity?An excess of ketone bodies in the blood causes ketoacidosis. Consider the chemical structure of the ketone bodies (only two out of the three ketone bodies cause this effect) and explain why they are acids.