The values of pK, for CH;CO¿H and CF;CO2H are 4.75 and 0.23, both of which are very nearly independent of temperature. Suggest reasons for this difference.
Q: Suppose a sample of refrigerant gas consisting of a simple mixture of the gases pentafluoroethane…
A:
Q: In a chemical reaction old bonds are broken and new ones formed. Therefore reaction enthalpies can…
A: The balanced chemical equations for the combustions of the two substances are:
Q: A student conducted an experiment to determine the Ksp of Ca(OH)2 at T = 298 K. The value he…
A: Solubility product(Ksp) is the equilibrium constant for a solid substance dissolving in an aqueous…
Q: Chlorodifluoromethane (CHF2Cl) was widely used in the compression/cooling circuits of refrigeration…
A: Given: Density of mixture = 3.06 g/L. Temperature = 14 oC And pressure = 0.974 atm.
Q: Suppose a sample of refrigerant gas consisting of a simple mixture of the gases pentafluoroethane…
A: In this question we will first find out the average molecular mass, given the density(d),…
Q: 20.7 cm3 of a pure vapour, at 1.136 atm, and 98.3 °C has a mass of 0.0603 g. Calculate the molar…
A:
Q: A pellet of benzoic acid standard was combusted in a bomb calorimeter to determine the experimental…
A:
Q: A pellet of benzoic acid standard was combusted in a bomb calorimeter to determine the experimental…
A: First determine the heat released, Q=(∆H) (∆ng) (n)where, ∆H=−3228.0kJ/mol = −3228000J/mol…
Q: widely used in the compression/cooling circuits of refrigeration or air-conditioning systems. Since…
A:
Q: What is the ArxnG° (in KJ/mole) for a mole of an ideal gas as pressure changes from 0.1 Pa to 1 x105…
A: Given, Number of moles of ideal gas = 1 mole Pressure changes from 0.1 Pa to 1 * 105 Pa Required,…
Q: 13.3p. If you allow one pound of carbon dioxide to sublime (change from CO2(s) to CO2(g)) at room…
A: If you allow one pound of carbon dioxide to sublime (change from CO2(s) to CO2(g)) at room…
Q: a) NH3 (aq. 1.5 M) + HCI (aq. 1.5 M) NH,CI (aq. 0.75 M) and b) NH,CI (s) - NH4CI (aq. 0.75 M) Using…
A: The enthalpy of the reaction is considered as the state function that is it depends only on the…
Q: pellet of benzoic acid standard was combusted in a bomb calorimeter to determine the experimental…
A:
Q: Chlorodifluoromethane (CHF2Cl) was widely used in the compression/cooling circuits of refrigeration…
A:
Q: C5) Calculate AGng (in J) for the mixing of 4 fi0 moles of He (1 bar, 298.15 K) with 2.60 mol of Ne…
A:
Q: Calculate AH and AUf for the formation of silane, SiH4(g), from its elements at 298 K, if 250 cm³ of…
A: Calorimeter is a device used for measuring heat change in a chemical reaction. Constant volume…
Q: .1. Given the reaction 2 FeH, + 3 Pbo → Fe,0, + 3 PbH, + H, And under these reaction conditions the…
A: Δ G0rxn = ΔG0 of products - ΔG0 of reactant,
Q: What is AG (in kJ) for 2 SO2(g) + O2(g) 2 SO3(g) at 700 K, under standard conditions of 1 bar…
A: Given :- 2SO2(g) + O2(g) → 2SO3(g) K at 700 K = 3.0 × 104 To calculate :- ∆G (in kJ)
Q: What is the standard enthalpy of a reaction for w hichthe equilibrium constant is (a) doubled. (b)…
A: The given data contains, Temperature = 308 K.
Q: The enthalpy of neutralization of a newly discovered compound, J(OH)3, was determined using a…
A:
Q: What is the purpose and content of the experiment to determine the calorimeter constant and the…
A: In this question, we have to find out the correct answer of given problem by the help of calorimeter…
Q: Determine the standard enthalpy change and std. Gibbs free energy change of reaction at 400 k for…
A: Given: ∆H0f, CO (g)= -26.41 kcal/mol∆H0f, CH3OH (g)= -48.08 kcal/mol∆H0f,H2 (g)= 0 kcal/mol∆G0f, CO…
Q: Write three equivalent KP relations for reacting ideal-gas mixtures ?
A:
Q: If Sº in J/mol-K is 20 for H2SO4(aq), 20 for SO42-(aq), 141 for NaBr(aq), & 59 for Na+(aq), Sº for…
A: Given data: So for H2SO4 = 20 J/K mol So for NaBr = 141 J/K mol So for Na+ = 59 J/K mol
Q: Suppose a sample of refrigerant gas consisting of a simple mixture of the gases pentafluoroethane…
A: Given, Let mass of sample =1 L Density of mixture = 3.06gL Temperature = 14°C Pressure = 0.974 atm
Q: Write the expression for the Kt of H,PO;. HPO OH K = [H2 PO,) %3D K = [H2 PO ] H& PO, H3O*] [H2PO;]…
A: Kb is the dissociation constant of the base.
Q: Differentiate between circumstances for the use of nRln(V2/V1) ??? Cvln(T2/T1) in calculating change…
A:
Q: You have a calorimeter with a heat capacity of 0.426 kJ/ºC. You combine 50.0 mL 1.50 M NaA (A- =…
A: Given data,Heat capacity of calorimeter=0.426kJ/oCInitial temperature=18.6oCFinal temperature=21.1oC
Q: 2) Calculate the amount of limc(ca0) that Gon be propared by heating 200 kq of limestone that is 95…
A: CaCO3 ------------> CaO + CO2.
Q: A fuel has the following volumetric analysis: CH4 = 68% C2H6 = 32% Assume complete combustion with…
A: Given the composition of air is 68% CH4 and 32% C2H6. Excess air required = 15%
Q: Given that the standard enthalpy of formation of HCl(aq) is −167 kJ mol−1, what is the value of…
A: Standard enthalpy of formation of HCl(aq) is, ΔfHo[HCl(aq)] = −167 kJ mol−1 To calculate:…
Q: The enthalpy of neutralization of a newly discovered compound, J(OH)3, was determined using a…
A: #(a): The balanced equation for the reaction between HCl(aq) and NaOH(aq) is: HCl(aq) + NaOH(aq)…
Q: distinguish between the circumstances for the use of nRln(V2/V1) and Cvln(T2/T1) in calculating…
A: Entropy is measure the randomness of the particles. Entropy is denoted by S. Given relationship: Cv…
Q: Determine the rote low ex pression for the following recxtion and give units for k.
A: In rate law expression : Rate is equation is written as product of concentration of reactants with…
Q: What is the equilibrium pressure of O 2(g), in bar, over a sample of NiO(s) at 298 K, given that Δ…
A: The given chemical equilibrium reaction is as follows: NiO(s) ↔ Ni(s) + 12O2(g) Δ rG˚ = 218.4 kJ =…
Q: A pellet of benzoic acid standard was combusted in a bomb calorimeter to determine the experimental…
A: Benzoic acid (C6H5CO2H) is often used for this purpose because it is a crystalline solid that can be…
Q: 1. Write the reaction for the dissolution of Ca(OH)2, as well as the Ksp expression for the…
A: Since you have asked multiple questions, we will solve the first question for you. If you want any…
Q: Explain the effect of temperature on the extent of physical and chemicaladsorption.
A: Adsorption is surface phenomenon. It is concentration of molecules of liquid (or) gas over the solid…
Q: What are the values of ΔH and ΔS (in kJ>mol) for the change from gaseous toliquid H2O?
A: The Gibbs free energy denoted by G, combined enthalpy and entropy into a single value. The change in…
Q: 4. Suppose 5 mL of 1.5 M ethylene diamine is added to 50 mL of 0.15 M Ni solution in an identical…
A:
Q: For the reaction below, formation salpies at 1 bar and standart entropies are given. Çe te…
A:
Q: Chlorodifluoromethane (CHF2Cl) was widely used in the compression/cooling circuits of refrigeration…
A: #1: Given the mixture contains pentafluoroethane (C2HF5) and 111-trifluoroethane (C2H3F3). density…
Q: 10. What is ∆G for the decomposition of CaCO3 at 298K and a partial pressure of CO2 of 4*10-4 bar?…
A: Given data: ∆Gfo for CaCO3(s) = -1129 kJ/mol, ∆Gfo for CaO (s) = -604 kJ/mol, ∆Gfo for CO2(g) = -394…
Q: What is the heat of precipitation of barium sulphate if volume of both reactants sodium sulphate and…
A: We know 1cm3 = 1ml 1dm3 = 1000cm3 Concentration is 1mol/1000cm3 So, in 1 cm3…
Q: The enthalpy of neutralization of a newly discovered compound, J(OH)3, was determined using a…
A: #(a): The balanced equation for the reaction between HCl(aq) and NaOH(aq) is: HCl(aq) + NaOH(aq)…
Q: The standard enthalpy of formation of gaseous H20 at 298 K is -241.82 kJ/mol. V heat capacities at…
A: Given reaction is H2 (g) + 1/2 O2 (g) --> H2O (g) molar heat capacity…
Q: The enthalpy of the following reaction at 1.00 atm and 298.15K is -56.9kJmol-1 H* (ag) + OH (ag)…
A:
Q: Calculate AA'R and AG'R for the reaction CEH6() + 15/2 O2(g) - 6CO2(9) + 3H2O() at 298 K from the…
A:
Q: Calculate the value of ΔHm − ΔUm for the reaction C6H12O6(s) + 6 O2(g) → 6 CO2(g) + 6 H2O(l) at 298…
A: Given C6H12O6 (s) + 6 O2 (g) → 6 CO2 (g) + 6 H2O(l) Δng = 6-6 =0 Formula ΔHm − ΔUm = ΔngRT = 0…
Q: molar enthalpy of formation of H2O(l) from its elements in their standard states (25 oC and 100…
A: The standard molar enthalpy of formation of a compound is the change in enthalpy during the…
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 2 images
- (a) NBS, hv 1A Br (b) Mg/Et,0 -CH3 1B > 10 NBS, 1 eq. (c) - 1D + 1E + 1F heat Brzieроxide 1G Br2/H20 1H H,SO,, heat 11 (d) ноThe reaction of ethanol with ethanoic acid produces ethyl ethanoate and water. CH;OH() + CH,COOH() - CH,COOC,H,(1) + H,0(1) A student suggested that the yield of ethyl ethanoate, CH,COOC,H,, could be increased by removing the water as it was formed. Explain, using the idea of K, why this suggestion is sensible.(b) Bn MezSiO., MezSiO,, Ме -78 °C, CH2C12 MeO CHO MeO ОН
- Calculate delta H for the following rection, FeO + CO = Fe + CO2 from the following data: Fe2O3 + 3CO --> 2Fe +3CO2 Delta H= -23 kJ 3Fe2O3 + CO --> 2Fe3O4 +CO2 Delta H= -39 kJ Fe3O4 +CO --> 3FeO +CO2 Delta H= +18 kJWrite the expression for Kc for the following reactions. Ineach case indicate whether the reaction is homogeneousor heterogeneous.(a) 3 NO1g2 ∆ N2O1g2 + NO21g2(b) CH41g2 + 2 H2S1g2 ∆ CS21g2 + 4 H21g2(c) Ni1CO241g2 ∆ Ni1s2 + 4 CO1g2(d) HF1aq2 ∆ H+1aq2 + F-1aq2(e) 2 Ag1s2 + Zn2+1aq2 ∆ 2 Ag+1aq2 + Zn1s2(f) H2O1l2 ∆ H+1aq2 + OH-1aq2(g) 2 H2O1l2 ∆ 2 H+1aq2 + 2 OH-1aq23. A particular protein heat denatures with a melting temperature Tm = 332 K with an enthalpy of unfolding, AHm = 372 kJmol-¹. (a) What is the entropy of unfolding in kJ mol-1 K-1 at Tm? (b) If ACp is 6.6 kJ mol-1 K-1, at what temperature does the free energy of unfolding (AG unfolding) have the greatest value (i.e. the native state is most stable)? (c) Calculate the value of AG and K at this temperature.
- Find the variance (F) for the following equilibria: (i) 2 CaSO4(s) ↔ 2 CaO(s) + 2 SO2(g) + O2(g) (2) (ii) CuSO4·3H2O(s) ↔ CuSO4·H2O(s) + 2 H2O(g) (2) (iii) NH4Cl(s) ↔ HCl(g) + NH3(g), when the equilibrium is approached by starting only with the solid.17D.1. (a) What is the specific heatof liquid water? (b) What is themolar heat capacity of liquid water?(c) What is the heat capacity of 185 gof liquid water? (d) How many kJ ofheat are needed to raise thetemperature of 10.00 kg of liquidwater from 24.6 °C to 46.2 °C?Briefly distinguish between circumstances for the use of nRIn(V2/V1) and CvIn(T2/T1) in calculating change in S
- for the equilibrium PH3BCI3(s)=PH3(g)+BCI3(g) Kp=0.052 at 60degreesCelsius calaculate KcCalculate the equilibrium constant for the phosphorylation of glucose to glucose 6-phosphate at 37.0 °C. 4.74 x10¬3 M-1 eq In the rat hepatocyte, the physiological concentrations of glucose and P; are maintained at approximately 4.8 mM. What is the equilibrium concentration of glucose 6-phosphate (G6P) obtained by the direct phosphorylation of glucose by P;? 8.75 x10-8 [G6P] = M IncorrectSolute S has a partition co-efficient of 3.0 between water (Phase 1) and Chloroform (Phase 2). (a) Calculate the concentration of S in chloroform if [S(aq)] is 0.015 M. (b) If the volume of water is 75.0 mL and the volume of chloroform is 15.0 mL, find the quotient (mol S in chloroform)/(mol S in water).