Part B. Classify Fatty Acids as Saturated or Unsaturated 2. Identify each fatty acid below as saturated or unsaturated: a) CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂COOH b) CH,CH,CH,CH,CH,CH,CH,CH,CH=CHCH,CH,CH,CH,CH,CH,CH,COOH c) CH₂(CH₂),(CH=CHCH₂)₂(CH₂),COOH d) CH₂(CH₂)10 COOH e) CH₂(CH₂),CH=CH(CH₂),COOH f) CH₂CH₂(CH=CHCH₂)3(CH₂),COOH Fatty acid Saturated or Unsaturated a) b) c) d) e) f)

Part B. Classify Fatty Acids as Saturated or Unsaturated 2. Identify each fatty acid below as saturated or unsaturated: a) CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂CH₂COOH b) CH,CH,CH,CH,CH,CH,CH,CH,CH=CHCH,CH,CH,CH,CH,CH,CH,COOH c) CH₂(CH₂),(CH=CHCH₂)₂(CH₂),COOH d) CH₂(CH₂)10 COOH e) CH₂(CH₂),CH=CH(CH₂),COOH f) CH₂CH₂(CH=CHCH₂)3(CH₂),COOH Fatty acid Saturated or Unsaturated a) b) c) d) e) f)

Biology Today and Tomorrow without Physiology (MindTap Course List)

5th Edition

ISBN:9781305117396

Author:Cecie Starr, Christine Evers, Lisa Starr

Publisher:Cecie Starr, Christine Evers, Lisa Starr

Chapter2: Molecules Of Life

Section: Chapter Questions

Problem 4CT: In the following list, identify the carbohydrate, the fatty acid, the amino acid, and the...

See similar textbooks

Similar questions

Another key component of lipids is a fatty acid. A fatty acid is recognizable by its carboxyl group. butyric acid caproic acid lauric acid 0 || -C-0-H OHHH H-O-C-C-C-C-H HHH OHHHHH Ö|||||| H-O-C-C-C-C-C-C-H ││││| HHHHH Carboxyl group OHHHHHHHHHHH H-0-C-C-C-C-C-C-C-C-C-C-C-C-H ….......... HHHHHHHHHHH a. Draw a box around the carboxyl group on each fatty acid. b. The molecular formula for butyric acid is C_H_O___. c. The molecular formula for caproic acid is C_H_O___. d. The molecular formula for lauric acid is C_H_O____
1. a. How will you classify Lipids? Differentiate the Simple, Compound and Derived lipids. b. Write down the details about structure and functions of fatty acids.
+ J. Draw the structure of the following molecules and complete the table. Aldose/ Pentose/ Mono/Di/ Poly Structure Ketose Нехове Glucose Fructose Lactose Sucrose Starch CONCLUSION
Identify the structures shown as glycerophospholipids or sphingolipids.
A. Identify the following fatty acids present in fats and oils by their common names. Acid Common name 1. HO- H;C (CH2);0- 2. H3C (CH2)12- -OH H,C (CH2)14-Ö-OH 3. H,C (CH2)16- -OH 4. H3C(CH2)18 -HO- 5. 6. Which of the above is the most abundant fatty acid? 7. What is the general formula of a saturated fatty acid?
Classify the following fatty acids. Choices: Long chain fatty acids Medium-chain fatty acids short-chain fatty acids Lauric acid Oleic acid Butyric acid Stearic acid
Describe aldoses and ketoses. Describe triose, tetrose, pentose, hexose and heptose. Describe monosaccharide and list at list three examples. Describe disaccharide and list at list three examples. Describe polysaccharide and list at list three examples. Describe functions of carbohydrates. Describe the polymerization process of carbohydrates. Describe the degradation process of carbohydrates. What is the bond between sugars in a polysaccharide? Describe the function of sugars in protein structures and functions.
Which one of the following would be a valid symbol identifier of the fatty acid shown below? HO 22:6(D5,8,11,14,17,20) 22:6(D3,6,9, 12, 15, 18) 22:5(w-4) 22:6(w-3) 22:6(w-6)
The symbol for the fatty acid below is ________________: ________________, n-____________________. CH3(CH2)2(CH=CHCH2)2(CH2)4COOH (This is a multiple blank question, e.g. for 12:1, n-3 you would enter 12, 1, and 3.)
02-CH-CH Gln12 Regions of 2 receptors that interact on dimerization are shown below. Identify the types of interactions between amino acids based on their interacting side chains (figures of amino acids also provided). Receptor 1 Cys36 Cys$2 CH2 Receptor 2 HS-H2 S-CH Ala45 CH, Cys75 Asp68 HN-CH-CH-CH-CHst Lys65 CH Ser53 -CH,-OH HN CH H,C Phe50 Val98 Interacting Amino Acids Type of Interaction Ser53:Gln12 Asp68:Lys65 Cys75:Cys82 Phe50:Val98 Amino Acids: H. H-C-CH,- H-C-CH, H-C-CH,CH,CCH,-N,
Identify the type of lipid in each compound. Glycerophospholipids are a class of phospholipids. ва C19H39 COOH CH₂(CH₂)28CH3 НННННННН Н ......... с-с-с-с-с-С-С-С-С-С-Н III НННН Н Н Н Н Н НННН НННН Н II I L I I 1 TU с-с-с-с-с-с-с-с-С-С-Н FIT III ННН H НННН Н НННН Н Н LI I I . С-С-С-С-С-С-С O ННННН HO Н3С(СН2)15 :-0 H-C-O H-C-0 H d wax fatty acid triacylglyceride steroid prostaglandin phospholipid Н Н -0- HO .COOH -CH₂
Which is NOT true about fatty acids? Select the correct answer below: In a triglyceride, the fatty acids are attached to each of the three carbons of the glycerol molecule with an ester bond through an oxygen atom Fatty acids have a long chain of hydrocarbons to which a ketone group is attached Fatty acids most commonly contain 12–18 carbons The number of carbons in a fatty acid may range from 4 to 36. Please explain each