Which of the following carbaxylic acid derivatives are present in che molecule shown? CI 1. Lactone 2. Amide 3. Ester 4. Anhydride 5. beta-keto ester O 3 and 5 O 1 and 3 O 2 and 3 D 3 and 4
Q: a. This mo Br sites of electrop HO. you've c and we'l b. он С. HO.
A: Here we have to write IUPAC name and the key reactive sides present in the given compounds.
Q: For the following molecules, list them from low boiling point to high boiling point, and list the st...
A: SiH4 PH3 CH3OH
Q: What is the molar solubility of BaF2 (Ksp = 1.8 x 10-7) in a solution containing 0.33 M KF(aq)?
A: BaF2(aq) -----> Ba+2(aq) + 2F-(aq) Ksp = 1.8 x 10-7
Q: can you please do 4-6. show synthesis, synthons and disconnections OH но. 77 3. ÓH 4. ??? 777 5. 6.
A:
Q: What the time l submevs ion in day ot Brass alloy (25%2n, 45%. cu) , avea was 10 cm2, that 2.5 Kg ノ ...
A: Given, Brass alloy having 25%zinc and 75%copper Area-10cm2 Weight of NACL displaced by brass-2.5kg ...
Q: Ore is a naturally occurring solid material (essentially a rock) from which a metal or valuable mine...
A:
Q: What is the ΔrG° for the following reaction (in kJ mol-1)? N2 (g) + O2 (g) + Cl2 (g) ⇌ 2 NOCl (g)
A: Recall the reaction, N2 (g) + O2 (g) + Cl2 (g) ⇌ 2 NOCl (g) ΔrG° = ?
Q: Discuss how TNG, ISDN and ISMN cause nitrate tolerance and endothelial dysfunction.
A:
Q: The solubility of ferric hydroxide is 4.8 x 10 g/100 mL at room temperature. Calculate its solubilit...
A: Solubility can be defined as the maximum amount of a substance that dissolve in a particular amount ...
Q: Reflection Read and analyze the statement below and answer the corresponding questions in a separate...
A: A question based on environmental pollution that is to be accomplished.
Q: A 3.40 gram mixture of potassium chlorate KCLO3, and potassium chloride, KCL, was heated until all o...
A: Given, KClO3(s) ➝ KCl(s) + O2(g) Balancing the above equation, 2KClO3(s) ➝ 2KCl(s) + 3O2(g) Pressure...
Q: Retrosynthesis. Provide reagent(s) that would accomplish each of the following reactions. 2 CO
A: Introduction : Coupling reaction in organic chemistry is a term use for those types of reactions in...
Q: Illustrate the electron spin quantum number of Boron
A: Quantum mumbers are used to describe position of electrons in orbitals of an atom. There are four di...
Q: Stability by Hyperconjugation: A
A: Stability of alkenes can be expained by hydperconjugation Displacement alpha C-H sigma electrons ...
Q: Griven domats of cyclohexame is o-7785glm and AHamb=-46.6KI|| Hole Many Jaurneddo vreleade ag mmuch ...
A: Heat of combustion is the heat energy released when 1 mol of a substance is burnt.
Q: Answer the following questions. 116.0 117.0 117.5 118.0 128.0 130.0 153.0 154.0 155.0 156.0 2.2 4.0 ...
A:
Q: Classify each of the following acids as strong or weak. Drag the appropriate items to their respecti...
A: The classification of acids are given below
Q: Part C H2PO3 Express your answer as a chemical formula. ΑΣΦ DA chemical reaction does not occur for ...
A: Conjugate acid and conjugate base:
Q: Calculate the concentrations of all species present in a 0.18 M solution of ethylammonium chloride (...
A: Given, the concentration of C2H5NH3Cl = 0.18 M Ka for C2H5NH3+ = 1.8×10-11 We have to calculate the ...
Q: What's the partial pressure of carbon dioxide in a container that holds 5 moles of carbon dioxide, 3...
A: Calculate partial pressure of CO2 in the mixture ?
Q: Which of the following has the largest effect upon resistance? O A. valves B. vasomotion OC. viscosi...
A: Resistance can be defined as the opposition offered by a substance to the flow of electric current
Q: ROOR HBr hv or A ROOR b. HBr hv or A LI. NH,
A:
Q: a. Cr(OH)3 + Br2 → CrO4- + Br¯ in basic solution
A: a) Write balanced equations for the reaction in basic medium---
Q: Write a schematic diagram of the procedure for the synthesis of tert- Butyl chloride by an Sn1 react...
A:
Q: Be sure to answer all parts. Consider the following equilibrium at 447.9 K: NH,HS(s) S NH3(g) + H,S(...
A: In the given questions, We first need to calculate Kp since partial pressure of gases is given.Then...
Q: Consider the following reaction 8A(g) + 5B(g) → 8C(g) + 6D(g) If [C] is increasing at the rate of 4....
A:
Q: Consider the following reaction where K. = 2.90x10 2 at 1150 K. 2503(g) 2S02(g) + 02(g) A reaction m...
A:
Q: k-CO2 Bn Bn0 Me LO Bn PMA. 0z Eta SiH OBn Ph -OBn MeoM
A:
Q: 1.) NaOEt, EtOH 2.) HCI, H2O, heat
A:
Q: 7.94 mL of 0.11 M hydroxide ion is added to 25.00 mL of 0.11 M monoprotic strong acid. What is the p...
A:
Q: 4. How much heat is released when 29.5 grams of Cl2 (g) reacts with excess hydrogen? H2 (g) + Cl2 (g...
A: Given, H2(g) + Cl2(g) ➝ 2HCl(g) ∆H° = -186 kJ Note: negative sign indicate the release of energy as...
Q: What is the structure of compound C for the following reaction scheme? Zn(Hg) SOCI, AICI3 Compound A...
A:
Q: A strong acid is a corrosive substance that can cause skin burns. If a strong acid is accidentally s...
A: Strong acid is substance which release hydrogen ions when dissolved in water. Strong base is substan...
Q: Calculate (H30*] in the following aqueous solution at 25 °C: [OH¯] = 6.9x10-12 M . %3D Express your ...
A: Given :- [OH-] = 6.9 x 10-12 M To calculate :- [H3O+] and also determine the nature of solution
Q: Part A Based on molecular structure, arrange the following oxyacids in order of increasing acid stre...
A:
Q: a. Draw as many possible resonance structures of the molecule, (show the direction of electron trans...
A:
Q: If 100.0 mL of potassium dichromate solution (10.0 g of K2Cr207 per liter) was mixed with 75.0 mL of...
A: First, we have to find the molarity of each of the K2Cr2O7(aq) or Cr2O72-(aq) and FeSO4.7H2O or Fe2+...
Q: At equilibrium, a reaction vessel contains 4.50 atm of Br, and 1.10 atm of NB.3. According to the re...
A: Given Pressure of Br2 = 4.50 atm Pressure of NBr3 = 1.10 atm Reaction: 2 NBr3 (g) ⇌ N₂ (g) + 3 Br₂ ...
Q: ble. ease see Separation by Precipitation 2 for assistance. (a) Which of the metals would precipitat...
A: a. at pH=6, it is tin Ksp= [Pb2+] [OH-]2 = 4*10^-3 * 10^-16 = 4*10-19 < 4 x 10-15(unsaturated sol...
Q: Some chemical reactants are listed in the table below. Complete the table by filling in the oxidatio...
A: Calculate oxidation state of highlighted atom --
Q: Calculate the concentration of H3O* in a solution that contains 5.5 x 10-5 M OH at 25°C. Identify th...
A: For an aqueous solution, we know that the production of the concentration of the hydrogen ions and t...
Q: Consider the following reaction where Ke = 6.30 at 723 K. 2NH3(g) EN2(g) + 3H2(g) A reaction mixture...
A: The equilibrium constant of a chemical reaction is the value of its reaction quotient at chemical eq...
Q: The radioactive isotope Thallium-201 is used in medical diagnosis and treatment. A gamma ray emitted...
A:
Q: Calculate the change in entropy associated with the Haber process to produce ammonia from nitrogen a...
A: N2 (g)+3H2 (g)⇌2NH3(g) So(H2) = 130.6 J/mol K So(N2) = 191.50 J/mol K So(NH3) = 192.5 J/mol K
Q: In your own words, differentiate between an endothermic and exothermic reaction in one complete sent...
A: In this question, we have to differentiate between an endothermic and exothermic reaction in one com...
Q: 3. Use the balanced equation below to answer questions a-d. 4 NH + 3 Ozg) → 2 N2 + 6H2O@ a. How many...
A: a) Given, 4NH3(g) + 3O2(g) ➝ 2N2(g) + 6H2O(g) Moles of O2 are needed to react with 28.0g of NH3 =? N...
Q: 4. Two tanks are connected by a closed valve. Each TANK A tank is filled with gas as shown in the gi...
A:
Q: f. 2-ethyl-cyclopentane-1,3- dicarboxylic acid ortho-hydroxybenzoic acid g.
A:
Q: The initial concentrations or pressures of reactants and products are given for each of the followin...
A: (a) 2 NH3 (g) ⇌ N2 (g) + 3 H2 (g) Kc=17; [NH3] = 0.50 M, [N2] = 0.15 M, [H2] = 0.12 M (b) 2 SO3 (g)...
Q: The equilibrium constant Kc for the reaction below is 0.00785 at a certain temperature. Br2(g) ⇌ ...
A:
Step by step
Solved in 2 steps with 1 images
- Functional Group Classes Alcohol Amide Ester • CH₂CH₂OH * CHIO-CH, 7. H₂C1O Amine Ketone Circle each functional group(s) and identify the class to which each of the groups belongs. 9. H₂C Aldehyde Thiol Aromatics Carboxylic Acid 2. CH,SH 6. Alkenes 4. H₂NCH₂CH₂ 10. Ether NM₂ 11. Which of the functional groups in the top list must be on a terminalC in the carbon chain?I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.9. Which of these compounds has chemical properties most similar to the chemical properties of ethanoic acid? 1. C₂H-COOH 2C₂H₂OH 3. C₂H5COOC₂H5 4. C₂H5OC₂H5
- 10. Why are carboxylic acids more acidic than alcohols? Click or tap here to enter text.ent X Chapter 13.1 - Carboxylic Acids X X Question 9 of 19 Provide the correct systematic name for the compound shown here. O 3- # 80 F3 $ Q F4 % 9 F5 4- N 2- | N,N- N- N,N,N- tri tetra di but eth prop meth pent hex oic acid amine al MacBook Air C F6 1 Aktiv Chemistry & F7 + DII F8 DD F9 A F10 F11 +Which is not a carboxylic acid derivative? O A. amides O B. ethers O C. esters D. anhydrides
- Organic chemistry II Home My courses Pharmacy Sem 3 Organic chemistry II L6 : C.Acid derivatives -Esters and Amides Assignment 4 Assignment 4 1. Write 10 molecular and structural formula for each of the following Aromatic carboxylic acid derivative? Acid chloride Acid anhydride Acid Amide ester. 2. Name the above 40 compounds.QUESTION 3 What is the class name of the following structures? CH3 CH2 CH3 CH CH2 CH3 OA Aldehyde О В. Ketone OC. Alcohol O D.Carboxylic Acid O E. Carboxylate Salt O F. Ester QUESTION 4 What is the class name of the following structures? OA Aldehyde OB. Ketone OC Alcohol O D.Carboxylic Acid OE Carboxylate Salt OF EsterC Cont W k 1 ol Univ app.101edu.co Maps YouTube esc 1 Cont - F1 Q 9 A N Aktiv OH 2 Bb BIOC A X Univ Dr. HCC Sear Univ Bb BIO Mail Cont Question 1 of 19 What type of class of molecule is formed in the reaction illustrated here? A) aldehyde B) ketone C) ester + LOH Ht, heat D) carboxylate salt E) carboxylic acid F9 F2 W S X 1 H option command #m 3 80 F3 E D C $ 4 F4 R F do 5 % V F5 T G 6 MacBook Air F6 B Y H 7 N F7 U 8 J DII F8 M ( 9 Nath TPA G unive a Thar K O H O L F10 P F11 { + 11 I command option Do G self [ I ? F12 } ] + + Update Submit delete re
- Each of the following acids contains an additional type of functional group besides the carboxyl group. For each acid, specify the non-carboxyl functional group present. 12. Glycolic acid13. Fumaric acid14. Pyruvic acid15. Malic acid16. Tartaric acidAmide hydrolysis in basic conditions forms A. a carboxylic acid and an amine B. a carboxylate salt and an amine 3. an ester and an amine 4. a carboxylic acid and an amine saltWhich statement is true about the molecule below? H₂ C. It is a strong acid. It is a strong base. H3C NH₂ It is a weak base but a stronger base than an a similar amine. It is a very weak base, even weaker than a a similar amine.