The selectivity coefficient, Kg+.H*, for a K* ion-selective electrode is 0.00240. When the electrode is placed into a 8.56 x 10-5 M K* solution at pH 6.66, the potential is –0.186 V vs. SCE. If the pH of the solution is lowered to 1.40 and the ionic strength is kept constant, what is the potential of the electrode? Assume ß = 1 for the electrode.

The selectivity coefficient, Kg+.H, for a K ion-selective electrode is 0.00240. When the electrode is placed into a 8.56 x 10-5 M K* solution at pH 6.66, the potential is –0.186 V vs. SCE. If the pH of the solution is lowered to 1.40 and the ionic strength is kept constant, what is the potential of the electrode? Assume ß = 1 for the electrode.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 50QRT

See similar textbooks

Similar questions

Calculate the electrode potentials for the following systems: (a) Cr2O72-(5.00 10-3 M),Cr3+(2.50 10-2 M),H+ (0.100 M)|Pt (b) UO22+(0.100 M),U4+ (0.200 M),H+ (0.600 M)|Pt
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)