The ester group can be written as -COO- in condensed structural formulas. Providethe condensed structural formulas of the products of the following ester saponificationreaction.НeatCH3-CH2-COO-СН2-CH2-СН2-CH3 + КОНO CH3-CH2-CH2-OK + HO-CH2-CH2-CH2-CH3O CH3-CH2-COOH + K* O-CH2-CH2-CH2-CH3O CH3-CH2-CH2-OH + COO K"-CH2-CH2-CH2-CH3O CH3-CH2-COO K* + HO-CH2-CH2-CH2-CH3

Answered: Image /qna-images/answer/520529a9-fda4-4e42-b2a2-d85b1b640c69.jpg

The ester group can be written as -COO- in condensed structural formulas. Provide the condensed structural formulas of the products of the following ester saponification reaction. Heat CH3-CH2-COO-CH2-CH2-CH2-CH3 + KOH O CH3-CH2-CH2-OK + HO-CH2-CH2-CH2-CH3 O CH3-CH2-COOH + K* O-CH2-CH2-CH2-CH3 O CH3-CH2-CH2-OH + COO K"-CH2-CH2-CH2-CH3 O CH3-CH2-COO K* + HO-CH2-CH2-CH2-CH3

The ester group can be written as -COO- in condensed structural formulas. Provide the condensed structural formulas of the products of the following ester saponification reaction. Heat CH3-CH2-COO-CH2-CH2-CH2-CH3 + KOH O CH3-CH2-CH2-OK + HO-CH2-CH2-CH2-CH3 O CH3-CH2-COOH + K* O-CH2-CH2-CH2-CH3 O CH3-CH2-CH2-OH + COO K"-CH2-CH2-CH2-CH3 O CH3-CH2-COO K* + HO-CH2-CH2-CH2-CH3

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter16: Carboxylic Acids, Esters, And Other Acid Derivatives

Section: Chapter Questions

Problem 16.120EP

See similar textbooks

Similar questions

Write the systematic (IUPAC) name for each of the following organic molecules: structure CH₂ оно CH₂-N-CH₂-CH₂-C CH₁ CH₂-CH₂-CH-CH₂N-CH₂ NH CH₂ CH₂ CH₂ name N-ethyl-N-methyl-1-propanamine N-methyl-N-propyl-1-pentanaming 0
What is the IUPAC name of the following Organic Compound? OH Ⓒ6-hydroxy-3-propylheptan-2-onc 5-cthanoyloctan-2-ol 3-propylheptanoic acid 03-buytl-3-hydroxyhexan-2-onc 2-hydroxy-5-propylheptan-6-one 9-hydroxydecan-2-onc
Which of these compounds is the ester formed from the reaction of ethanoic acid and 1-gr CH3-C-O-CH₂-CH2-CH3 0 0 CH3-CH2-CH₂-O-CH₂-C-OH 0 OH 1 CH3-CH₂-C-OH 1 O-CH)-CH3 CH3-CH₂-C-0-CH₂-CH3 OH 1 CH3-C-OH O-CH2-CH2-CH3
Give the common name for NN OH T CH3-CH₂-C-N-CH₂-CH3 Spell out the common name of the compound. Give the IUPAC name for 0 CH₂ || CH₂-C-N-CH₂-CH₂-CH₂, Spell out the IUPAC name of the compound. diethylamine Draw all missing reactants and/or products in the appropriate boxes by placing atoms on the canvas and connecting them with bonds. Add charges where needed. HE CONT HO
Draw the condensed structural formula for all products obtained from the following Hydrolysis reaction: H2C-0-C-(CH) 14CH3 HC-0-C-(CH) 14CH3 H2C-0-C-(cCH) 14CH3 +3 КОН ->
614 Give the IUPAC name for each of the following 5-14 carboxylic acids. a. CH3-CH2-CH2-CH2-C-OH CH3 CH3 bilk b. CH—CH-СН,—С—ОН CH3 CH3 O c. CH3-CH-CH-C-OH CH-CH—С-ОН d. CH3-CH,—СH,—СООН
CH,CH,CH,-OH Draw the structure of the product expected when each of the following alcohols is reacted with a sulfuric acid catalyst au the temperature indicated. H,SO, CH,-CH-CH, 180°C a. OH H,SO, CH, — CH—СH,—ОН 180°C b. CH; H,SO, CH-CH-OH 140°C с. CH, CH,-CH-CH,-CH, H,SO, d. 140°C d. OH
H H +4 H H H- H- H- H H H H H- H H H H H H -0-H -N- H H H H -0-H alcohol carboxylic acid amine aldehyde ketone
Name: 2) When water is introduced into an ester under high temperature conditions, esters are hydrolyzed into their carboxylic acid and alcohol components. Draw the structure of the resulting carboxylic acid and alcohol when the ester shown below is hydrolyzed. + H20 3) Why is it important that the test tube be thoroughly dry before making esters? Use the principles of chemical equilibrium to explain your answer.
Select the correct systematic name of each ester. H3 C- methyl acetate methyl ethanoate ethyl methanoate 2-propanoate H3C-CH2-CH₂- 3-heptanoate propyl butanoate butyl propanoate propyl butanate -CH3 -CH₂-CH2-CH3
Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: о CH2-0-C-(CH2)7-CH=CH-CH2-CH=CH-(CH2)4-CH3 CH о O-C-(CH2)7-CH=CH-CH2-CH=CH-CH2-CH=CH-CH2-CH3 CH2-O-C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)4-CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource.
When H2O is added to the following molecule