Q: Question 14 The compound below has 8 rotatable bonds. Without removing any carbon, oxygen, or…
A: The original molecule has two six-membered rings, each with three rotatable bonds. This means there…
Q: How long will it take for the concentration of A to decrease from 0.500 M to 0.200 M in the…
A:
Q: Help with organic chem 1
A: Step 1: Step 2: Step 3: Step 4:
Q: None
A: Step 1:Given compound has a carboxylic acid group (-COOH). Step 2:An amide group (-CONH) is…
Q: What molar concentration of hydrazine, N2H4 (Kb = 1.7 x 10^-6) yields a solution with a pH of10.46?
A: The objective of this question is to find the molar concentration of hydrazine, N2H4 that yields a…
Q: Give the major organic product of the following reaction for a) or b)
A: Step 1: The ether group is an electron-donating group that favours para- and ortho-substitution…
Q: A reaction fask starts with a sample of 2 (g) and is gently warmed, whereupon some of the iodine…
A: Step 1:To find the equilibrium constant for the reaction , we first need to understand that the…
Q: The deuterated alcohol shown can be converted to an alkyl halide via a mesylate intermediate.…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: 5. What is the name of the alcohol shown below, including relevant stereochemistry? (4 pts) CH3 H3C…
A: Step 1: Step 2: Priority order is assigned based on the atomic number of the groups present at the…
Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2+ 2103 (aq)…
A: Step 1: Step 2: Step 3: Step 4:
Q: A certain electrochemical reaction has an Eocell = 1.13 volts. The value of n for the reaction is 1.…
A: The objective of the question is to calculate the standard Gibbs free energy change (ΔGo) for an…
Q: When the kinetic study in Question 23 was repeated at different temperatures, an Arrhenius plot of…
A: The objective of the question is to calculate the enthalpy of activation (ΔH‡) at 298K using the…
Q: 9. Which reagent from the list below reacts with R-2-butanol to form only S-2-bromobutane? (3 pts)…
A: When R-2-butanol reacts with PBr3, it initiates a transformation known as a substitution…
Q: + single electron occupies a subshell and has the quantum numbers n = 2, { = 1, ml = -1, ms = +2.…
A: Quantum numbers are a set of four numbers used to describe the unique properties of an electron…
Q: Calculate the solubility at 25°C of Ni(OH), in pure water and in a 0.0100M NaOH solution. You'll…
A: Thank you,Please rate my response.
Q: Chemistry
A: Step 1: Step 2: Step 3: Step 4:
Q: The image upload answer is not allowed please my jiger
A: Given the equilibrium expression for a particular reaction, substitute the concentrations of each…
Q: I U X2 More Formatting A A Q 4. A fluoride ion selective electrode was used to analyse for fluoride…
A: (i)The equation of the standard curve is y = -59.049 x - 194.91we can find the concentration of the…
Q: In 1932, James Chadwick discovered a new subatomic particle when he bombarded beryllium-9 with alpha…
A: The objective of the question is to identify the subatomic particle discovered by James Chadwick in…
Q: D A B OH Which of these is a diterpene ? OH
A: Diterpenes are made up of 4 isoprene unitsOnly structure in option D is made up of 4 isoprene units
Q: Please don't provide andwritten solution ...
A: Starting Materials:Isobutanol (2-methyl-1-propanol)Reagents:Potassium dichromate (K2Cr2O7) -…
Q: How many delocalized and localized longifinitrogen atoms for the following compound? S NH2 localized…
A: Step 1:Localized lone pair: A lone pair of electrons on an atom in a molecule that is confined to a…
Q: 4. Purpose the synthesis for the following transformations (d) NH2 Ν
A: There is no direct route in the synthesis of enamine from amide. What we can do is convert the amide…
Q: The following acid-base reaction occurs spontaneously in the gas phase: NH₃(g) + HCl(g) ⇌ NH₄Cl(s)…
A: To solve this problem, we need to use the equilibrium constant expression and the given…
Q: Predict the equilibrium concentration of NH in the reaction described below (for which Kc = 1.210 at…
A: 2.The ICE table for given reactionKc is an equilibrium constant based on the concentration term, is…
Q: Please don't provide handwritten solution .... what is the product
A: Approach to solving the question:This is acid-catalyzed acetal hydrolysis. The acetals are…
Q: Part A What would be the expected major product of the following reaction? H.C CH3 + Cl₂
A: Step 1: Step 2: Step 3: Step 4:
Q: Propose the synthesis of the 1-Phenyl-1,4-pentanedione compound by a malonic or acetylacetic…
A:
Q: molecule? A) 3 B) 4 C) 5 D) 6 Place a circle around each of the 5 stereocenters for the structure…
A: A stereocenter, also known as a chiral center, is a specific type of atom within a molecule,…
Q: What are the units for the rate constant for a seventh order reaction?
A: The objective of the question is to determine the units for the rate constant (k) for a seventh…
Q: Using the thermodynamic information in the ALEKS Data tab, calculate the standard reaction entropy…
A: In calculating the standard entropy of a reaction, we simply take the difference between the sum of…
Q: make sure it’s correct
A:
Q: Please don't provide handwritten solution ...
A: Step 1:In this step first time free radical is formed, thus this step is called initialization or…
Q: The Fischer projection for D-glyceraldehyde (R stereochemistry) is: CHO нон CH2OH Which compound has…
A: Step 1: Step 2:Option A. has the same configuration (stereochemistry).
Q: 9) An economy car has an EPA highway mileage rating of 22 km/L. What is the mileagerating in miles…
A: The objective of this question is to convert the mileage rating from kilometers per liter (km/L) to…
Q: Which statement describes the relationship between reactants and products in an exothermic reaction?…
A: Correct option:d. the reactants have more bond energy and are less stable than the products.This…
Q: How many amperes are required to deposit 0.122 grams of manganese metal in 501 seconds, from a…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: Use the References to access important What volume of ethylene (C2H4) is required to react…
A:
Q: Consider a 1M solution that is prepared using the salt NH4NO3. The pKb of ammonia is 4.7 and the pKa…
A: The objective of the question is to determine which statements are accurate about the contents of a…
Q: make sure the drawing is correct and everything is correct
A: A & Cb.) The organic reaction that occurs between glycerol and fatty acid is called…
Q: 5) How many minutes is required for sunlight to travel from the Sun to Mars? (Assume the Sun is 1.14…
A: For question 5, the objective is to find out the time taken for sunlight to travel from the Sun to…
Q: This is from a study guide for a final, not a graded assignment.
A:
Q: A heliox deep-sea diving mixture delivers an oxygen partial pressure of 0.25 atm whne the total…
A: The objective of this question is to find the partial pressure of helium in a heliox deep-sea diving…
Q: Help label all the peaks and determine the functional groups present Note any wide bands or…
A: The objective of the question is to identify the functional groups present in the compound Cr(acac)3…
Q: Gallium-67 is used in nuclear medicine. After treatment, a patient's blood shows an activity of…
A: The objective of this question is to determine the time it will take for the activity of Gallium-67…
Q: What is the ph of the resulting solution if we mix 150 ml of .150N HPO4-2
A: To find the pH of the solution when mixing 150 mL of 0.150 N HPO4^2- (dihydrogen phosphate), we must…
Q: In this part, you will assume that your unknown and the second compound are both dissolved in…
A: When performing chemical extraction with an ether layer, the choice of extracting the analyte using…
Q: = A certain half-reaction has a standard reduction potential Ered +1.24 V. An engineer proposes…
A: 1. Yes, there is a minimum standard reduction potential that the half-reaction used at the anode of…
Q: Draw the formulas for the following reaction:D-Allose + NaOH (very dilute) = Product
A:
Q: Indicate with formulas the reaction 5-Methylisoquinoline + sodium amide
A: The reaction between 5-methylisoquinoline and sodium amide (NaNH2) is an example of a base-induced…
Step by step
Solved in 2 steps with 1 images
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…
- when ethanoic acid reacts with diethylamine, provide the IUPAC of the major product formedwhat are the strcutures for the follwoing a) butyrate reacts with methyl butyrate reacts wuth ethyl butyrate reacts with 1-propyl butyrate reacts with 2-propyl b) hexonoate reacts with methyl hexonate reacts with ethyl hexonante reacts with 1-propyl hexonate reacts with 2-propyl c) benzoate reacts with methyl benzoate reacts with ethyl benzoate reacts with 1-propyl benzoate reacts with 2-propyl d) cinnamate reacts with methyl cinnamate reacts with ethyl cinnamate reacts with 1-propyl cinnamate reacts with 2-propylProvide an IUPAC name for the structure.
- Draw a structural formula of the principal product formed when benzonitrile is treated with reagent. Q.) H2O (excess), H2SO4, heat1) Nitriles are typically hydrolyzed to form what class of compounds? 2) what must one keep in mind when performing the hydrolysis of a nitrile to a carboxylic acid? 3) why are nitriles over-looked as carboxylic acid derivatives?Question 25 of 27 Identify the class of compound that forms a ketone upon reaction with a Grignard reagent (RMGX) followed by hydrolysis of the reaction mixture. A) ester B) nitrile C) acid chloride D) acid anhydride 49% 34°F pe here to search