Pure acetic acid is a viscous liquid, with high melting and boiling points (16.7 °C and 118 °C) compared to compounds of similar molecular weight. Suggest an explanation.

Q: Give the IUPAC Name

A: In IUPAC nomenclature systen first we have to select the longest chain of the hydrocarbon consider…

Q: Give the IUPAC name

A: The naming of an organic compound can be done with help of rules of international union of pure and…

Q: Directions: Arrange these fatty acids (all contain 18 carbon atoms) in order of increasing melting…

A:

Q: What is/are the intermolecular forces of 1,3-diphenyl-2-propyn-1-one.

A: Intermolecular forces refer to the type of interactions which are present in between atoms or…

Q: Give the IUPAC name for following compound.       CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2

A: International Union of Pure and Applied Chemistry gave guidelines to write the chemical name of…

Q: Give the structure formula for the given IUPAC name in clear handwritten!

A:

Q: Give the IUPAC name for attached compound

A: The IUPAC (International Union of Pure and Applied Chemistry) name of the given compound is:

Q: GIVE THE IUPAC NAME FOR THE FOLLOWING STRUCTURE : CH3 CH3 H3C H3C ČH3

A:

Q: Question is attached

A: Boiling point  It is defined as temperature at which vapour pressure of a liquid equals the pressure…

Q: Are the London dispersion forces the same for all molecules in the table or are they different and…

A: The instantaneous dipole-induced dipole attractions are called London dispersion forces   these…

Q: Benzoic acid is insoluble in ethyl alcohol but soluble in water * O true O false

A: There is a statement given which is : Benzoic acid is insoluble in ethyl alcohol but soluble in…

Q: Arrange these compounds in order of increasing boiling point.Explain your reasoning.a. CH4 b. CH3CH3…

A: Rules :  1) When the molecular mass of molecules are too different (i.e not approximately same) than…

Q: Give A Summary of Substitution and Elimination Reactions of Alcohols ?

A: Number of functional group is associated with organic compounds which impart specific chemical and…

Q: Give the IUPAC name for following compound.           (CH3)3CCH2CH(CH2CH3)2

A: In the given compound, the longest hydrocarbon chain consist of 6 carbon atom, hence the compound is…

Q: 2. Differentiate acetic acid from hydrochloric acid in terms of. a. Boiling point b. Acidity c.…

A: Since question 1 is incomplete  so I am calculating second question which contains  multiple…

Q: Give the IUPAC NAME

A:

Q: Suppose that 1.00 mL of isopentyl alcohol was reacted with excess acetic acid and that 1.00 g of…

A: Density of isopentyl alcohol = 0.81 g/cm3 1 cm3 = 1 mL

Q: Give the IUPAC name for attached compound.

A: Various organic compounds are studied in chemistry. To avoid confusion between scientists regarding…

Q: Propanol is very soluble in water, but ethanethiol and chloroethane are only slightly soluble.…

A: Solubility of a substance in a solution follows the rule of like dissolves like. This shows that…

Q: Arrange these compounds in order of increasing boiling point. Explain your reasoning.a. H2S b. H2Se…

A: Boiling point is that point when liquid changes its form into vapor form. It is done when vapor…

Q: 3.1 Provide the structu No IUPAC names are necessa H2 (еxces Pd H2O H* Br2 UV light

A: Given are different reactions. Let's see products of them.

Q: Draw the structure of C4H1,0 if the compound: (1) reacts with Na but fails to react with a strong…

A: The proposed structure and their respective equations are

Q: но

A: Give IUPAC name of the following--

Q: Why do alcohols have boiling points much higher than hydrocarbons of similar molecular weight? a.…

A:

Q: You are given the task to prepare the maximum possible amount of 1-bromobutane from the following…

A: Given: Volume of 1-butanol = 4.9 mL density of 1-butanol = 0.810 g/mL concentrated of sulfuric acid…

Q: Rank the following compounds in order of increasing melting point.

A: The given molecules are represented as follows:

Q: • Provide the classification (alcohol or ether) and provide the correct IUPAC name of each molecule.…

A: Answer:- This question is answered by using the simple concept of nomenclature of organic compounds…

Q: What are the IUPAC Name and Molecular formula of the structure?

A: 1. Select the principle carbon chain 2. Numbering 3. Naming (prefix + word root + suffix)

Q: Write the condense structure of the following compound 4. 2- Butanone 5. Heptanoic Acid

A: The condensed structural formula is a shorthand representation of an organic molecule. In the…

Q: Give the IUPAC names.

A: 1. Here, the basic structure is cyclohexane. Here, two substituents are present. Ethyl at C-1 and…

Q: Give the IUPAC name for attached compound.

A: IUPAC provides general rules for naming the compounds. The given compound is aromatic in nature…

Q: Draw fully displayed structure for 2,4-dimethyl-5-nitrodecanoic acid

A: We have to write structure for 2,4-dimethyl-5-nitrodecanoic acid

Q: From their structures, explain why 1-hexanol is more soluble in ether than water and why boric acid…

A: A hydrogen bond is a bonding form between polar molecules in a solution state with a water molecule.…

Q: Give the IUPAC names

A: IUPAC nomenclature rules for alkenes: 1) Identify the longest continuous carbon chain. 2) Identify…

Q: Give the IUPAC name for attached compound.

A: Interpretation-  To give the IUPAC name for the attached compound -   Concept- To write the IUPAC…

Q: Differentiate acetic acid from hyrochloric acid in terms of: a. boiling point b. acidity c.…

A:

Q: Give an example of any optically inactive compound with at least 4 carbons and show its structure

A:

Q: Explain why the following compounds have the indicated boiling points. All three are polar, have…

A: Boiling point depends on intermolecular force of attraction as well as on hydrogen bonding .

Q: Please mark the correct statement below. A. Since 2.1 g of an alkene containing a double bond reacts…

A: Since 2.1 g of an alkene containing a double bond reacts (exactly) adduction with 8 g of bromine,…

Q: Why does lactic acid have a boiling point of 122 ° C?

A: Lactic acid have intermolecular forces of attraction like London dispersion forces of dipole-Dipope…

Q: Draw the structure for: 1. 3-isobutyl heptanoicaid and or 2. ethyl 2-isopropylpentanoate

A:

Q: Give the IUPAC name:

A: IUPAC  nomenclature is used for naming organic compounds. Full form of IUPAC IS INTERNATIONAL UNION…

Q: Give the IUPAC name.

A: The given compound consist of a benzene ring which consist of OCH3 group and CH2CH=CH2.

Q: 8. Give three structural formulas each of acyclic and carbocyclic compounds having the composition…

A:

Q: Write a generalized statement regarding the solubility of hydrocarbons in a polar solvent (water)…

A: Solubility of hydrocarbon in a polar solvent (water) = Hydrocarbons are insoluble in water. This is…

Q: Differentiate petroleum ether and sulfuric ether in terms of boiling point Your answer Cite two…

A: The can be explained as

Q: give the IUPAC name

A: For IUPAC name you have to  1st consider the longest carbon chain containg the functional group and…