Please balance the equation using the half reaction method. ASAP! Thank you! f) S_(2)O_(4)^(2-)+Cu(NH_(3))_(4)^(2+)rarrSO_(3)^(2-)+Cu (basic conditions) 1//2rxn.
Q: II) a-Draw the proper Haworth form and most stable chair conformation for ß-anomer of…
A: Given structure
Q: During a recrystallization, if more solvent than necessary was used, how would the recovery be…
A: Since you have posted multiple questions, we will provide the solution only to the first question as…
Q: Sodium carbonate can be made by heating sodium bicarbonate: 2NaHCO3(s) → Na2CO3(s) + CO₂(g) + H₂O(g)…
A:
Q: 1) For each compound, complete the following steps: a) Write a complete, balanced combustion…
A:
Q: 12. When 30.0 mL of 1.00 M HCl(aq) and 45.0 mL of 1.00 M NaOH(aq), both at 21.0 °C, are added to a…
A: Answer:When acid and base solutions are mixed together then high exothermic neutralization reaction…
Q: N-H 1) KOH 2) 3) H₂NNH₂ Br J K [H*], NaBH₂CN L [H], NaBH,CN M [H], NaBH₂CN NH₂ HN R R
A: ketone compound reacts with amine to form imine product which is reduced by NaBH3CN to form amine…
Q: After a substance acting as a strong base reacts, what remains of the base? Select one: a. a weaker…
A:
Q: 1. For a solution whose pH is 6.0, what is [H+]? If [H+] is 5 x 10-7 M, what is the pH? (answer =…
A: • For a solution,pH = 6.0[H+] = ?• For a solution, [H+] = 5 × 10-7 MpH = ?Note: The relationship…
Q: A neutral object is sketched below, in black and white. There are positive and negative electric…
A: Opposite charges tends to attract each other.Positive charge attracts negative charge towards it,…
Q: How are the differences within a series of salt dilutions and between the two salts associated with…
A: The ionic strength of a solution quantifies the presence of ions within the solution. When ionic…
Q: 4. a. A buffer is prepared by mixing 0.900 mole of ammonia and 0.850 mole of ammonium chloride to…
A: Before additionconcentration = mol / volume[ NH3] = 0.9/0.5 = 1.8 M[NH4Cl] = 0.85/0.5 = 1.7 MpKa of…
Q: Complete and balance the following equation in acidic environment. MnO4 + H+ + Br →Mn²+ + Br₂ + H₂O…
A:
Q: Study the problem and proposed solution below. Is the final answer correct? Then click the No…
A: Given,the mass of a liquid = 27 kgthe density of a liquid = 825. g/L
Q: What is the IUPAC name for the following compound? عد Methyl 3-methylbutanamide N-Methyl…
A: Answer:IUPAC is the internation union of pure and applied chemistry. Some set of rules has been…
Q: In which series are the elements listed in order of increasing electronegativity? L C
A: If the atoms of a covalent bond formed by the sharing of the electrons are different then the…
Q: A student sets up the following equation to solve a problem in solution stoichiometry. (The ? stands…
A: One unit is converted into another unit by using multiplicative factor.
Q: The industrial manufacture of Nylon 6 involves water initiated (hydrolytic) polymerization of…
A: Hydrolytic polymerization is a chemical reaction in which a monomer undergoes a reaction with water…
Q: Draw structures for the carbonyl electrophile and enolate nucleophile that react to give the aldol…
A: By removing the proton from carbons next to carbonyls (the "alpha-carbon"), enolates can be created.…
Q: Table 1: The physical characteristics of six unknown samples. Property Sample A Sample B Melting…
A: Covalent network solids consist of atoms covalently bonded into a three-dimensional network or…
Q: Predict the dominant form of the amino acid shown below at pH 10.0. Given: pKa a-carboxyl 2.2, pka…
A: Amino acids are amphoteric biomolecules that have both the acidic carboxylic acid COOH group and…
Q: Write balanced half-reactions for the following redox reaction: 12 Cu( reduction: oxidation:…
A: Oxidation:Loss of electrons or increase in magnitude of potive oxidation state or decrease in the…
Q: Draw a mechanism for the last step of the Gabriel synthesis, performed under basic conditions. N-R 0…
A: Organic reactions are those in which organic reactant react to form organic products. In the given…
Q: Using a table of standard reduction potentials, decide which of the following statements is…
A: Answer :----- The statement that is completely true is :-"H+ can oxidize Fe, and Ni can reduce Br2 "
Q: When a solid dissolves in water, heat may be evolved or absorbed. The heat of dissolution…
A: Given,The mass of CaBr2 = 2.16 gThe mass of water = 116.80 gInitial temperature of the solution =…
Q: From a wild plant, a natural flavouring ingredient was isolated and utilised to sweeten ice cream…
A: The molecular formula is defined as an expression which is used to define the number of atoms of…
Q: What is the major product for the following sequence?
A:
Q: An automobile engine generates 2200 Joules of heat that must be carried away by the cooling system.…
A: According to the first law of thermodynamics, where '' is the change in internal energy, 'q' is the…
Q: Which of the following would be classified as lecithins? (Select all that apply.) 0…
A:
Q: The image below shows the free energy (G) of a reaction as a function of the composition - all…
A: Answer:A chemical reaction will only be spontaneous in forward direction when value of Gibbs free…
Q: CI 1. Phthalimide, KOH 2. NaOH ? Major Organic Product
A:
Q: What is the IUPAC name of the following compound? i HCH
A: Steps required for IUPAC naming are-Identify the longest carbon chain containing most preferential…
Q: Describe what changes occur during beta decay. OA. The mass number and atomic number increase.. OB.…
A: Given process: beta decaychange in mass no = to be determinedchange in atomic no = to be determined
Q: (c) H₂(g) H(aq) + H¯(aq) V spontaneity: O spontaneous O not spontaneous balanced equation: chemPad…
A: Sorry but this is according to Bartleby guidelines,you have asked multiple questions. We will answer…
Q: Decide whether each of the molecules in the table below is stable, in the exact form in which it is…
A: In the given question we have find out that which compound is stable and which is unstable at basic…
Q: At a certain temperature this reaction follows second-order kinetics with a rate constant of 0.00997…
A: Rate constant = 0.00997 M^-1S^-1 Initial concentration= 0.670 M Time= 730 second
Q: Consider the complete combustion of butanol (C4H100), as indicated in the balanced reaction below.…
A:
Q: Here is a graph of the molarity of butyl chloride (C4H₂C1) in a reaction vessel during a certain…
A: Given us a graph of molarity of butyl chloride in a glass vessel during a certain chemical reaction.
Q: There are three sets of sketches below, showing the same pure molecular compound (water, molecular…
A: Given Molecule: H2OMelting point of H2O: 0oCBoiling point of H2O : 100 oCGiven temperature…
Q: Use the Standard Reduction Potentials table to pick a reagent that is capable of each of the…
A: We have to determine the reagent whose potential satisfy the given condition which is .,To oxidise…
Q: What is the DH vap in kilojoule, kJ, of a liquid that has a vapor pressure of 641 torr at 85.2°C and…
A:
Q: Draw the skeletal ("line") structure of a 3 alcohol with 6 carbon atoms, 1 oxygen atom, and no…
A: The classification of alcohol is done on the basis of the number of carbon atoms attached to the…
Q: solution until the concentration falls to 4.00 M. He'll do this by adding distilled A chemist must…
A: When we dilute a concentrated solution with pure water, the mole of solute remains constant in the…
Q: What is the correct set of Starting Material that can complete this transformation
A: The Diels–Alder reaction is a pericyclic reaction (cycloaddition) between a conjugated diene and a…
Q: H₂N NH3+ COOH Arginine Lysine O Valine Proline
A: The given compound Chemical formula is.,COOHCH(NH2)CH2CH2CH2CH2NH3+
Q: How many sigma bonds and how many pi bonds are represented inthis structure? C3HNC1₂
A: The covalent bond is formed by the overlap of the atomic orbitals between the atoms of similar…
Q: Determine the chemical formula for the compound, lithium tris(oxalato)chromate(III) OA.…
A: The coordiantion compound lithium tris (oxalato) chromate (III) have three oxalate group since Tris…
Q: The preparations of two aqueous solutions are described in the table below. For each solution, write…
A: Answer:Compound that gives H+ ion in a solution is called as Bronsted-Lowry acid and any compound…
Q: +2 +1 +1
A: Answer:Opposite charges attracts each-other and same charges repel each-other and magnitude of that…
Q: What is the reducing agent in the redox reaction represented by the following cell notation? Cd(s) |…
A: In an electrochemical cell, electrical energy is produced from the spontaneous cell reaction at the…
Q: Convert the following measurement. 0.659 g 2 = 0 L mg dL
A: 1 g = 1000 mg1 L = 10 dL
Please balance the equation using the half reaction method. ASAP! Thank you!
f) S_(2)O_(4)^(2-)+Cu(NH_(3))_(4)^(2+)rarrSO_(3)^(2-)+Cu (basic conditions) 1//2rxn.
Please type answer note write by hend.
Step by step
Solved in 5 steps with 10 images
- A solid sample containing some Fe2+ weighs 2.360 g. It required 36.44 mL 0.0244 M KMnO4 to titrate the Fe2+ in the dissolved sample to a pink end point. The balacned redox reaction is shown below. 8H++MnO4 - +5Fe2+------>Mn2++5Fe3++4H2O 1.) How many moles MnO4 - were used in the titration? 2.) How many grams of Fe are there in the sample 3.) How many moles Fe2+ are there in the sample? 4.) What is the percentage of Fe(by mass) in the sample?REDOX REACTIONS: Work neatly to balance these equations using the half-reaction method. 7. MnO4- + C2O42- ---> Mn2+ + CO2 in acid8. Fe(OH)2 + MnO4- ---> MnO2 + Fe(OH)3 in base9. Fe(OH)2 + Pb(OH)3 ---> Fe(OH)3 + Pb in basePlease balance using the half reaction method ( MnO4) - + Fe ------ Mn 2+ + Fe 2+ ( acid) Sn 2+ + (IO3) - -------- Sn+4 + I - ( acid ) MnO4 - + (ClO2 ) - ------ MnO2 + I - ( base )
- (1) Identify each of the following half-reactions as either an 3. Combini... 2req oxidation half-reaction or a reduction half-reaction. Question Question half-reaction identification Question 4. Full Re... 2req Sn²*(aq) + 2e¯– Sn(s) 5. Reducti... 2req Al(s)- A³*(aq) + 3e¯ 6. Calculat... 2req (2) Write a balanced equation for the overall redox reaction. Use 7. Relation... 2req smallest possible integer coefficients. 8. Calculat... 2req + + 9. Calculat... 2req1) Using the line notation and the half-reaction information provided, answer the following questions. Zn (s) I zn" (ag) |I Cu?" (ag) I Cu (s) Zn" (ag) + 2e> Zn (s) E 0.763 V Cu" (ag) + 2e> Cu (s) Ea 0.339 V ) Write the oxidation half-reaction. b) Write the reduction half-reaction. c) Which metal is the anode? cathode? d) Write the balanced redox reaction. e) Calculate Eses (show work) 9 Determine the value of n 8) Write the expression for the reaction quotient, Q. h) Calculate the equilibrium constant, K. (show work)true or false 9 __ The equilibrium constant of a redox reaction can be calculated from the standard reduction potentials of involved redox couples at given temperature. __ The charge balance for mixture 0.5 M K2HPO4 + 0.1 M H3PO4 is : [ H +] = [ H2PO4 -] + [ HPO4 2-] + [ PO4 3-] + [ OH-] __ The reduction reaction always occurs at a cathode. __ In EDTA titration, the media pH can impact the conditional formation constant Kf ’ . __ Adding table salt into a sugar solution will result in the increasing activity of coefficient of sugar molecules.
- When the following equation of a redox reaction in acidic solution is properly balanced, what are the coefficients for Cr20,2-, Fe2+ H*, Cr3+, Fe3+, and H2O, respectively? _Cr20,2- + Fe2+ +_H* Cr3+ + Fe3+ + __H2O --> (А) 1, 3, 14, 2, 3, 7; (B) 1, 6, 14, 2, 6, 7; (C) 2, 10, 14, 2, 10, 7; (D) 2, 12, 28, 4, 12, 14(1) Identify each of the following half-reactions as either an 3. Combini... 2req oxidation half-reaction or a reduction half-reaction. Question Question half-reaction identification Question 4. Full Re... 2req H2(g)2H*(aq) + 2e¯ 5. Reducti... 2req |Cl2(g) + 2e →2CI'(aq) 6. Calculat... 2req (2) Write a balanced equation for the overall redox reaction. Use 7. Relation... 2req smallest possible integer coefficients. 8. Calculat... 2req + 9. Calculat... 2reqWhen you balance the reaction MnO4- + S2O32- ----- MnO2 + S4O62- in acid medium, there will be A. 12 H+ in the left of the balanced reaction B. 6 H+ in the left of the balanced reaction C. 10 H+ in the right of the balanced reaction D. 4 H+ in the left of the balanced reaction E. 8 H+ in the left of the balanced reaction
- I. Balance the equation using the half reaction method 1. Mn + (BiOs ) --( Mn04) + Bi (acid) 2. (Mno4) + (CIO2 )- MnO2 + (CIOA) MnO2 + (CIO.) (base)一回- 需 A OWLV2 | Online teaching and le eCovalentActivity.do?locator=assignment-take Update [Review Topics] [References] Use the References to access important values if needed for this question. How many amperes are required to deposit 0.219 grams of zinc metal in 710. seconds, from a solution that contains Znt A Submit Answer Retry Entire Group 9 more group attempts remaining 10:24 PM 5/16/2022 合合西o < 片.S9 +661. Balance this redox equation. Answer only using the lowest whole number coefficients (i.e. 0, 1, 2, 4, etc.) S2- + NO-3 +H+ + OH- + H2O > S + NO + H+ + OH- +H2O (acid)2. Balance this redox equation. Cl2 > ClO-3 + Cl- (base)