57. From data in Appendix 4, calculate AH, AS°, and AG foreach of the following reactions at 25°C.a. CH4(g) + 2O₂(g)CO₂(g) + 2H₂O(g)b. 6CO₂(g) + 6H₂O(1) →→ C6H₁2O6(s) + 60₂(g)Glucosec. P4010(s) + 6H₂O(1)4H3PO4(s)d. HC1(g) + NH3(g) → NH4Cl(s)

∆H° is the Standard enthalpy change for a reaction. ∆S° is the Standard entropy change for a…

From data in Appendix 4, calculate AH, AS, and AG for each of the following reactions at 25°C. a. CH₂(g) + 2O₂(g) →→ CO₂(g) + 2H₂O(g) b. 6CO₂(g) + 6H₂O(1) - →→→ C6H₁2O6(s) + 60₂(g) Glucose c. P40₁0(s) + 6H₂O(1) →→→→ 4H3PO4(s) d. HCl(g) + NH3(g) →→→→NH₂Cl(s)

From data in Appendix 4, calculate AH, AS, and AG for each of the following reactions at 25°C. a. CH₂(g) + 2O₂(g) →→ CO₂(g) + 2H₂O(g) b. 6CO₂(g) + 6H₂O(1) - →→→ C6H₁2O6(s) + 60₂(g) Glucose c. P40₁0(s) + 6H₂O(1) →→→→ 4H3PO4(s) d. HCl(g) + NH3(g) →→→→NH₂Cl(s)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 86E: Use the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .)...

See similar textbooks

Similar questions

9.96 Most first aid "cold packs" are based on the endothermic dissolution of ammonium nitrate in water: NH4NO3(s)NH4+(aq)+NO3(aq) H= 25.69 kJ A particular cold pack contains 50.0 g of NH4NO3 and 125.0 g of water. When the pack is squeezed, the NH4NO3dissolves in the water. If the pack and its contents are initially at 24.0°C, what is the lowest temperature that this bag could reach? (Assume that the ammonium nitrate solution has a specific heat of 4.25J g-l K-l, and that the heat capacity of the bag itself is small enough to be neglected.)
When 7.11 g NH4NO3 is added to 100 mL water, the temperature of the calorimeter contents decreases from 22.1 C to 17.1 C. Assuming that the mixture has the same specific heat as water and a mass of 107 g, calculate the heat q. Is the dissolution of ammonium nitrate exothermic or endothermic?
Actually, the carbon in CO2(g) is thermodynamically unstable with respect to the carbon in calcium carbonate(limestone). Verify this by determining the standardGibbs free energy change for the reaction of lime,CaO(s), with CO2(g) to make CaCO3(s).
Calculate H when a 38-g sample of glucose, C6H12O6(s), burns in excess O2(g) to form CO2(g) and H2O() in a reaction at constant pressure and 298.15 K.
Is the formation of ozone (O3(g)) from oxygen (O2(g)) spontaneous at room temperature under standard state conditions?
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
Another step in the metabolism of glucose, which occurs after the formation of glucose6-phosphate, is the conversion of fructose6-phosphate to fructose1,6-bisphosphate(bis meanstwo): Fructose6-phosphate(aq) + H2PO4(aq) fructose l,6-bisphosphate(aq) + H2O() + H+(aq) (a) This reaction has a Gibbs free energy change of +16.7 kJ/mol of fructose6-phosphate. Is it endergonic or exergonic? (b) Write the equation for the formation of 1 mol ADP fromATR for which rG = 30.5 kJ/mol. (c) Couple these two reactions to get an exergonic process;write its overall chemical equation, and calculate theGibbs free energy change.
Wet limestone is used to scrub SO2 gas from the exhaust gases of power plants. One possible reaction gives hydrated calcium sulfite: CaCO3(s) + SO2(g) + H2O() CaSO3 H2O(s) + CO2(g) Another reaction gives hydrated calcium sulfate: CaCO3(s) + SO2(g) + H2O() + O2(g) CaSO4 H2O(s) + CO2(g) (a) Which reaction is more product-favored at equilibrium? Use the data in the table below and any other information needed in Appendix L to calculate rG for each reaction at 25 C. (b) Calculate rG for the reaction CaSO3 H2O(s) + O2(g) CaSO4 H2O(s) Is this reaction product- or reactant-favored at equilibrium?
For the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).
Use the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .) a. b. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq) c. MgO(s)+H2O(l)Mg(OH)2(s)
Reword the statement in Question 109 so that it is always true. Criticize this statement: Provided it occurs at an appreciable rate, any chemical reaction for which rG 0 will proceed until all reactants have been converted toproducts.
Use the appropriate tables to calculate H for (a) the reaction between copper(II) oxide and carbon monoxide to give copper metal and carbon dioxide. (b) the decomposition of one mole of methyl alcohol (CH3OH) to methane and oxygen gases.