Exactly 1.0 mol N,04 is placed in an empty 1.O-L container and allowed to reachequilibrium described by the equation N204(s)= 2NO,(g).If at equilibrium the N,04 is 28.0% dissociated, what is the value of the equilibriumconstant, K. for the reaction under these conditions?0.44O 2.30.310.780.11

Intial mole of N2O4 is 1mol. Vol. Of container is 1L. Given equation: N2O4(g) <-----> 2NO2(g).

Exactly 1.0 mol N204 is placed in an empty 1.0-L container and allowed to reach equilibrium described by the equation N204(8) = 2NO2(8). If at equilibrium the N204 is 28.0% dissociated, what is the value of the equilibrium constant, K. for the reaction under these conditions? 0.44 2.3 0.31 0.78 O 0.11

Exactly 1.0 mol N204 is placed in an empty 1.0-L container and allowed to reach equilibrium described by the equation N204(8) = 2NO2(8). If at equilibrium the N204 is 28.0% dissociated, what is the value of the equilibrium constant, K. for the reaction under these conditions? 0.44 2.3 0.31 0.78 O 0.11

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 45E: A 1.00-L flask was filled with 2.00 moles of gaseous SO2 and 2.00 moles of gaseous NO2 and heated....

See similar textbooks

Similar questions

Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Write a chemical equation for an equilibrium system that would lead to the following expressions (ad) for K. (a) K=(PH2S)2 (PO2)3(PSO2)2 (PH2O)2 (b) K=(PF2)1/2 (PI2)1/2PIF (c) K=[ Cl ]2(Pcl2)[ Br ]2 (d) K=(PNO)2 (PH2O)4 [ Cu2+ ]3[ NO3 ]2 [ H+ ]8
. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Write an equation for an equilibrium system that would lead to the following expressions (ac) for K. (a) K=(Pco)2 (PH2)5(PC2H6)(PH2O)2 (b) K=(PNH3)4 (PO2)5(PNO)4 (PH2O)6 (c) K=[ ClO3 ]2 [ Mn2+ ]2(Pcl2)[ MNO4 ]2 [ H+ ]4 ; liquid water is a product
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
12.101 An engineer working on a design to extract petroleum from a deep thermal reservoir wishes to capture toxic hydrogen sulfide gases present by reaction with aqueous iron(II) nitrate to form solid iron(II) sulfide. (a) Write the chemical equation for this process, assuming that it reaches equilibrium. (b) What is the equilibrium constant expression for this system? (c) How can the process be manipulated so that it does not reach equilibrium, allowing the continuous removal of hydrogen sulfide?
A 1.00-L flask was filled with 2.00 moles of gaseous SO2 and 2.00 moles of gaseous NO2 and heated. After equilibrium was reached, it was found that 1.30 moles of gaseous NO was present. Assume that the reaction SO2(g)+NO2(g)SO3(g)+NO(g) occurs under these conditions. Calculate the value of the equilibrium constant, K, for this reaction.
12.102 A chemical engineer is working to optimize the production of acrylonitrile to be used in the manufacture of carbon fibers. The reaction being used is the combination of propene gas, ammonia, and oxygen. The reaction is normally carried out at moderately high temperatures so all species are in the gas phase. (a) Write the equilibrium constant expression for this reaction. (b) The boiling point of acrylonitrile is 77 °C, and that of propene is -48 °C. What would the equilibrium expression be if this reaction were carried out at room temperature? (c) What characteristic of this reaction might cause the engineer to desire carrying out this reaction at room temperature?