Calculate the pH and the equilibrium concentrations ofHC6H606 and C6H6О6²- in a 0.1820 M ascorbic acidsolution, H₂C6H606 (aq).For H₂C6H606, Ka1 = 7.9x10-5 and Ka2 = 1.6x10-¹2pH =[HC6H606]] =[C6H606²-] =ΣΣ

Answered: Image /qna-images/answer/7b04785b-9531-46b9-bc76-c9d2ba925cff.jpg

Calculate the pH and the equilibrium concentrations of HC6H606 and СHО6²- in a 0.1820 M ascorbic acid solution, H₂C6H₁06 (aq). For H₂C₂H₂O6, Ka1 = 7.9×10-5 and Ka2 = 1.6×10-¹2 pH = [HC6H606¹] = [C6H606²-] = ΣΣ

Calculate the pH and the equilibrium concentrations of HC6H606 and СHО6²- in a 0.1820 M ascorbic acid solution, H₂C6H₁06 (aq). For H₂C₂H₂O6, Ka1 = 7.9×10-5 and Ka2 = 1.6×10-¹2 pH = [HC6H606¹] = [C6H606²-] = ΣΣ

Pushing Electrons

4th Edition

ISBN:9781133951889

Author:Weeks, Daniel P.

Publisher:Weeks, Daniel P.

Chapter3: Mechanisms

Section: Chapter Questions

Problem 31EQ: The reaction just described is reversible. Deprotonation of the conjugate acid of an organic base by...

See similar textbooks

Related questions

Q: Aqueous sulfuric acid H2SO4 will react with solid sodium hydroxide NaOH to produce aqueous sodium…

Q: 31 Balanced chemical equation: Mg + HCI -> Balanced ionic equation: wor Balanced net ionic equation:…

Q: In the balanced oxidation-reduction reaction (occurring in acidic condition) the coefficients before…

Q: d. e. f. HI HBr i. CH3CH₂MgBr ii. H3O+ HCI

Q: Calculate the mass percent of each element in Al2O3

Q: - k. SH HI excess CH3CO3H

A: The above reactions can be completed by filling the reactants, reagents or products with the help of…

Q: 100% hexanes U=unknown Y5=yellow 5 B1 = blue 1 R3 = red 3

A: Hexane is a non-polar solvent.

Q: Silicon has three isotopes: Silicon-28, Silicon-29, and Silicon-30. Which isotope is the most…

A: •So basically this question is based on mass of elements calculated from their isotopes and their…

Q: Which of the following compounds would require a Lewis structure that shows electrons were…

A: Note : Since you have posted multiple questions, we are entitled to answer the first only. Please…

Q: 6. A 25.00 mL aliquot of concentrated hydrochloric acid (11.7 M) is added to 175.00 mL of 3.25 M…

Q: Complete this radioactive decay series:

A: Given

Q: g e. CH3CH2CH(OCH3)CH2CH2CH2OH f. केभ

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Ammonia reacts with oxygen according to the equation 4 NH3(g) + 5O₂(g) → 4 NO(g) + 6 H₂O(g). If the…

A: The rate of the formation of the product or the rate of disappearance of the reactants is known as…

Q: 1. A chemistry 101 students has a sample of H₂(g) in a 4.7 L flask at a temperature of 34.6 °C and a…

Q: Name the following organic compounds:

A: Given : structure of molecules. Tip : select longest carbon chain for parent chain.

Q: If 58.3 mol of water are produced according to the reaction below, how many mol of oxygen were…

A: We need to use mole ratio between water and oxygen to calculate the moles of oxygen consumed.

Q: Determine the name of the product of the reaction shown here. -NH₂ + HBr ? A) cyclopentylamine B)…

A: Answer:- This question is answered by using the simple concept of chemical reaction of amine with…

Q: Naturally Occurring Isotopes of Copper Atomic Mass Isotope (atomic mass units, u) 62.93 64.93 Cu-63…

A: Cu - 63 atomic mass = 62.93 amu Abundance = 69.17% Cu - 65 atomic mass = 64.93 amu Abundance = 30.83…

Q: 4.) Provide mechanisms for the following reactions: + Br- CH3 CH3 CH3 CH3 AlCl3 CH3 of CH3 CH3 CH3

Q: Which species is formed when the CH3N₂* cation loses a nitrogen molecule? A. H3C B. H₂C: C. H3C. D.…

Q: Draw an alkyl halide and choose the best reaction conditions that would undergo an SN2 reaction to…

A: An azide ion (N3-1) is an excellent nucleophile and will readily participate in SN2 reactions with…

Q: mechanism that explains the formation of the following product. In your mechanism, explain the cause…

A: In this question, we have to explain the steps in the given mechanism.

Q: Steam and nitrogen gas are produced from nitrogen monoxide and hydrogen gas. Write the balanced…

A: Given data NO= 0.0500M H2= 0.150M. Trial # Nitrogen monoxide(M) Hydrogen gas(M) Initial…

Q: i. C₁7H36 plus oxygen gas j. magnesium metal plus silver nitrate

A: C17H36 (Heptadecane) this is an alkane. Alkane and O2 react and produce CO2 (carbon dioxide ) and…

Q: Gaseous water and solid calcium oxide are produced by the decomposition of solid calcium hydroxide.…

Q: Question 5 What are the stereochemistries of the two double bonds in the structure below? Piso 2…

Q: 3. A reaction has a rate constant of 0.000122 s¹ at 27.0°C and 0.228 s'at 77.0°C. a. Determine the…

A: Note: As the solution of first 2 questions has already been made, I am solving the 3rd question. As…

Q: An IR spectrum of p-cresol is acquired. Select the region of the spectrum where the C-O stretching…

A: P cresol is also caled as 4-methyl phenol.

Q: One day in lab, while taking apart a complicated distillation apparatus, your friend Teresa (an…

A: Balanced equation: It can be defined as the chemical equation where the number of each atom on the…

Q: When drawing a Lewis structure for a covalent compound, you need to know the total number of valence…

A: we have to calculate the number of valence electrons in Cl2CO

Q: Balance the chemical equation for the important industrial process: C2H4 + O2 + HCl → C2H4Cl2 + H2O.…

A: Given - C2H4 + O2 + HCl -> C2H4Cl2 + H2O Weight of C2H4 =710.0kg = 710000 gm (1kg = 1000gm)

Q: Exercise calculate the mean and standard deviation of the following set of analytical data. 15.67,…

A: Mean : It is defined as the average of all the observations. It is expressed as Mean = {Sum of…

Q: If your air conditioner is more than several years old, it may use the chlorofluorocarbon CCI₂F; as…

A: The total transition of this reaction is given by, Here heat releases as temperature is lowering…

Q: 10:0 b OH a OCH 3 OH . Write an equation for each of the following two-step reactions: -

A: Solution: We know hydroxyl group are bad leaving group so to remove it we have to make it as good…

Q: 2. Answer the following. Show all of your work. A. For a 0.1 M solution of Agt, what concentration…

A: [Ag+] =0.1 M Ksp of AgCl = Ksp = 1.8 x 10-10

Q: calculate [OH-]

A: we have to calculate the [OH-]

Q: Use the ideal gas equation to evaluate the average volume of a gas at the following conditions:…

Q: Evaporating sweat cools the body because evaporation is an endothermic process: H₂O(l) → H₂O(g) A…

A: we have to calculate mass of water that evaporated when body is cooled by 1.20 degree Celsius

Q: If 106 kJ of heat are evolved when the reaction described below is carried out, the mass of HCI gas…

A: First we need to calculate the moles of HCl has produced in given amount of heat evolved . Using…

Q: Calculate the acid ionization constant for butanoic acid if a 0.155 M solution is 1.15% ionized.…

Q: The following graph shows the pH curve for the titration of 25 mL of a 0.1 M monoprotic acid…

A: The given graph is a titration curve for the reaction between an acid and a base.

Q: дов H 1. NaBH4, CH₂OH 2. HCI, H2O 1. LiAIH4, THF 2. HCl, H2O

A: Given reactions are reduction reaction. NaBH4 and LiAlH4 both act as reducing reagent. LiAlH4 is…

Q: Pure magnesium metal is often found as ribbons and can easily burn in the presence of oxygen. When…

Q: An irregular lump of an unknown metal has a measured density of 5.26 g/mL. The metal is heated to a…

Q: Is the carbon labeled with an asterisk (*) a stereogenic center? Homework Unanswered Select an…

Q: How many moles of NH3 must be dissolved in water to give 622.4 mL of solution with a pH of 11.08? Ko…

A: Given -> Volume of solution= 622.4 ml = 0.6224 L (1L = 1000ml ) pH = 11.08 Kb = 1.8 × 10-5

Q: The following graph shows the pH curve for the titration of 25 mL of a 0.1 M monoprotic acid…

A: Curve shows end point at pH 7. So strong acid and strong base.

Q: g. h. i. OH HBr to HCI Br excess HS:

A: To find out the missing reagent as well as products we have to look out the detail mechanistic…

Q: 3. A fireproof safe is made of two thin metal boxes, one inside the other, with equal spacing…

A: When smaller box is placed in larger box , some of the volume will remain empty between the boxes.…

Q: What is the minimum temperature for reduction of CuO by carbon?

A: The minimum temperature for reduction of CuO by carbon.

Concept explainers

Acid Base Titration

An acid-base titration is the method of quantitative analysis for determining the concentration of an acid and base by exactly neutralizing it with a standard solution of base or acid having known concentration.

Question

Calculate the pH and the equilibrium concentrations of
HC6H606 and C6H6О6²- in a 0.1820 M ascorbic acid
solution, H₂C6H606 (aq).
For H₂C6H606, Ka1 = 7.9x10-5 and Ka2 = 1.6x10-¹2
pH =
[HC6H606]] =
[C6H606²-] =
ΣΣ

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The reaction just described is reversible. Deprotonation of the conjugate acid of an organic base by water provides another example of simultaneous making and breaking of sigma bonds. Thus, in the deprotonation of anilinium ion by water, the base is water, which has unshared electrons on the ________ atom. The acid is ________ ion. A pair of ________ electrons on the oxygen atom of water is pushed toward the ________ atom. Simultaneously, the pair of ________ electrons between the hydrogen and ________ atom of the anilinium ion is pushed toward the ________ atom. Thus, the oxygen- ________ sigma bond is made and a hydrogen- ________ sigma bond is broken. The nitrogen atom, which possessed a positive charge, is now ________, and the oxygen atom, which was neutral, now possesses a formal ________ charge.
The base protonation constant K, of lidocaine (C14H2]NONH) is 1.15 × 10 Calculate the pH of a 0.73 M solution of lidocaine at 25 °C. Round your answer to 1 decimal place. pH = ]
For the following reaction: NH(q) + H2SO(aq) ."NH (aq) +H5O,(99) Identify the correct description concerning Brønsted-Lowry acid/base conjugate pairs. H₂SO (aq) behaves as a Brønsted-Lowry base and it's conjugate acid is NH₂ (aq). H₂SO (aq) behaves as a Bransted-Lowry acid and it's conjugate base is NH,(aq). H₂50,(aq) behaves as a Brensted-Lowry acid and it's conjugate base is HSO, (aq). B NH₂(aq) behaves as a Brønsted-Lowry acid and it's conjugate base is NH, (aq). b
The following two acids react with water to form hydronium and the conjugate base, as shown below. HNO2 (aq) + H2O (1) = H3O* (aq) + NO2 (aq) НСООН (аq) + Н20 () — Нзо* (aq) + НСОО (aq) For each reaction, write the expression for the equilibrium constant K. ΚΗΝΟ2- KHCOOH %D
When NaCLO(s) dissolves in water it dissociates as follows NaCLO(s) + H2O(l) →Na+(aq) + CLO-(aq) is the conjugate base of the weak acid, hypochlorous acid, as follows: CLO- (aq) + H2O(l) ⇌HCLO(aq) + OH- (aq) How many grams of NaCLO must be added to 2.00 L of water to make a solution with a pH of 10.50? Kb = [HCLO-][OH-]/[CLO-] = 3.3x10−7 a) 0.46 grams b) 23 grams c) 0.31 grams d) 46 grams
A weak acid, HA, is a monoprotic acid. A solution that is 0.140 Min HA has a pH of 1.800 at 25°C. HA(aq) + H,0(1) 2 H;0"(aq) + A (aq) What is the acid-ionization constant, K, for this acid? What is the degree of ionization of the acid in this solution? Ka- Degree of ionization =
What is the pH of a grapefruit that contains 0.007 M citric acid solution (CsH2O-)? CH;O;(aq) + H;O(2) = CH;0, (aq) + H3Oʻ(aq) K, = 7.5 x 104 Round your answer to 2 decimal places.
CH3CH2CO2H , Ką = 1.3 x 105 CH3CH2CO2 , Kp = 7.7 x 10-10 F, Kp = 1.4 x 10-11 HF , Ką = 7.2 x 10-4 For the reaction between propanoic acid (CH3CH2CO2H) and a solution containing fluoride ions (F"): (a) The name of the conjugate base produced is (b) The name of the conjugate acid produced is (c) The reaction is favoured (write 'reactant' or 'product'), because the reactants are the (write 'weaker' or 'stronger') set of acid and base.
Identify the Bronsted-Lowry acid and base on the left side of the equation and the conjugate acid and conjugate base on the right side. HBr0 (aq) + H,0 (I) H30* (aq) + Bro (aq) HSO, (aq) + HCO, (aq) so, (aq) + H,CO3 (aq) 2- HSO; (aq) + H,0* (aq) H,SO; (aq) + H,0 (1)
Identify the acid, base, conjugate acid and conjugate base in the following reactions: HF (aq) + H,O (1) H;O* (aq) + F ¯(aq) CH;CH,NH, (aq) + H,O (1) CH;CH,NH;" (aq)+OH (aq)
The acid dissociation constant K, of alloxanic acid (HC,H;N,0,) is 2.24 x 10¬'. Calculate the pH of a 4.2 M solution of alloxanic acid. Round your answer to 1 decimal place. pH =
Calculate the concentration of HC6H₁06 in an aqueous solution of 4.81x10-2 M ascorbic acid, H₂C6H6O6 (aq). [HC6H606] = M.