At equilibrium, the concentration of the following components for the reaction below were found to be [N2] and [02] both equal to 0.300 M and the NO2 concentration is 0.500 M. If more NO2 is added, bringing the NO2 concentration to 0.700 M, what is the final concentration of N2 once the system re-establishes equilibrium?

At equilibrium, the concentration of the following components for the reaction below were found to be [N2] and [02] both equal to 0.300 M and the NO2 concentration is 0.500 M. If more NO2 is added, bringing the NO2 concentration to 0.700 M, what is the final concentration of N2 once the system re-establishes equilibrium?

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter9: Chemical Reactions

Section: Chapter Questions

Problem 9.76EP: Calculate the value of the equilibrium constant for the reaction N2(g)+2O2(g)2NO2(g) if the...

See similar textbooks

Similar questions

Calculate the value of the equilibrium constant for the reaction N2(g)+2O2(g)2NO2(g) if the concentrations of the species at equilibrium are [N2] = 0.0013, [O2] = 0.0024, and [NO2] = 0.00065.
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
The creation of shells by mollusk species is a fascinating process. By utilizing the Ca2+ in their food and aqueous environment, as well as some complex equilibrium processes, a hard calcium carbonate shell can be produced. One important equilibrium reaction in this complex process is HCO3(aq)H+(aq)+CO32(aq)K=5.61011 If 0.16 mole of HCO3 is placed into 1.00 L of solution, what will be the equilibrium concentration of CO32?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
7-29 The following reaction was allowed to reach equilibrium at 25°C. Under each component is its equilibrium concentration. Calculate the equilibrium constant, K, for this reaction.
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Based on the diagrams, chemical reaction, and reaction conditions depicted in Problem 9-81, for which of the diagrams is the numerical value of the equilibrium constant the smallest?
The following question is taken from a Chemistry Advanced Placement Examination and is used with the permission of the Educational Testing Service. Solve the following problem: MgF2(s)Mg2+(aq)+2F(aq) In a saturated solution of MgF2 at 18 C, the concentration of Mg2+ is 1.21103M . The equilibrium is represented by the preceding equation. (a) Write the expression for the solubility-product constant, Ksp, and calculate its value at 18 C. (b) Calculate the equilibrium concentration of Mg2+ in 1.000 L of saturated MgF2 solution at 18 C to which 0.100 mol of solid KF has been added. The KF dissolves completely. Assume the volume change is negligible. (c) Predict whether a precipitate of MgF2 will form when 100.0 mL of a 3.00103 -M solution of Mg(NO3)2 is mixed with 200.0 mL of a .2.00103 -M solution of NaF at 18 C. Show the calculations to support your prediction.. (d) At 27 C the concentration of Mg2+ in a saturated solution of MgF2 is 1.17103M . Is the dissolving of MgF2 in water all endothermic or an exothermic process? Give an explanation to support your conclusion.
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
How is the strength of an acid related to the position of its ionization equilibrium? Write the equations for the dissociation (ionization) of HCI, HNO3, and HClO4in water. Since all these acids are strong acids, what does this indicate about the basicity of the Cl-, NO3, and ClO4ions? Are aqueous solutions of NaCl, NaNO3, or NaClO4basic?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?