Aqueous hydrobromic acid (HBr) will react with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water (H2O). Suppose 73.6 g of hydrobromic acid is mixed with 19. g of sodium hydroxide. Calculate the minimum mass of hydrobromic acid that could be left over by the chemical reaction. Be sure your answer has the correct number of significant digits. g ☐ x10 ☑

Aqueous hydrobromic acid (HBr) will react with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water (H2O). Suppose 73.6 g of hydrobromic acid is mixed with 19. g of sodium hydroxide. Calculate the minimum mass of hydrobromic acid that could be left over by the chemical reaction. Be sure your answer has the correct number of significant digits. g ☐ x10 ☑

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Similar questions

3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
hat do the coefficients of a balanced chemical equation tell us about the proportions in which atoms and molecules react on an individual (microscopic) basis?
3.68 Magnesium is lighter than other structural metals, so it is increasingly important in the design of more efficient vehicles. Mg2+ ions are present in seawater, and the metal is often prepared by "harvesting" these ions and converting them to Mg metal. The average magnesium content of the oceans is about 1270 g Mg2+ per ton of seawater, and the density of seawater is about 1.03 g/mL. What is the molarity of Mg2+ ions in seawater? The design for a concept car calls for 103 kg of magnesium per vehicle. How many gallons of seawater would be required to supply enough magnesium to build one of these ears?
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?