A sodium ion-selective electrode increased in voltage by 59.16 mV when the sodium cation concentration was increased by a factor of 10. A S2-ion-selective electrode measured a decrease of 29.58 mV when the sulfide concentration increased by a factor of 10. Why? Select all that apply A. Cations always increase the measured potential by z x 59.16 mV where z is the charge on the cation. UB. Anions always decrease the measured potential by z x 59.16 mV where z is the charge on the anion. C. Cations always increase the measured potential by 59.16 mV/z, where z is the charge on the cation. D. Anions always decrease the measured potential by 59.16 mV/z, where z is the charge on the anion.

A sodium ion-selective electrode increased in voltage by 59.16 mV when the sodium cation concentration was increased by a factor of 10. A S2-ion-selective electrode measured a decrease of 29.58 mV when the sulfide concentration increased by a factor of 10. Why? Select all that apply A. Cations always increase the measured potential by z x 59.16 mV where z is the charge on the cation. UB. Anions always decrease the measured potential by z x 59.16 mV where z is the charge on the anion. C. Cations always increase the measured potential by 59.16 mV/z, where z is the charge on the cation. D. Anions always decrease the measured potential by 59.16 mV/z, where z is the charge on the anion.

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 147CP

See similar textbooks

Similar questions

Calculate the electrode potentials for the following systems: (a) Cr2O72-(5.00 10-3 M),Cr3+(2.50 10-2 M),H+ (0.100 M)|Pt (b) UO22+(0.100 M),U4+ (0.200 M),H+ (0.600 M)|Pt
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
Calculate the theoretical potential of each of the following cells. Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Pt|Cr3+(2.00 10-4M),Cr2+(1.50 10-3 M)||Pb2+ (5.60 0215 10-2M)|Pb (b) Hg|Hg22+(2.00 10-2 M)||H+(1.50 10-2 M),V3+ (2.00 10-2M),VO2+(3.00 10-3M)|Pt (e) Pt|Fe3+(3.00 10-2 M), Fe2+ (4.00 10-5M)||Sn2+ (3.50 10-2M), Sn4+ (5.50 10-4 M)|Pt