A cylinder measuring 9.8 cm wide and 12. cm high is filled with gas. The piston is pushed down with a steady force measured to be 18. N. piston cylinder gas do Calculate the pressure of the gas inside the cylinder. Write your answer in units of kilopascals. Round your answer to 2 significant digits.

A cylinder measuring 9.8 cm wide and 12. cm high is filled with gas. The piston is pushed down with a steady force measured to be 18. N. piston cylinder gas do Calculate the pressure of the gas inside the cylinder. Write your answer in units of kilopascals. Round your answer to 2 significant digits.

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter5: Gases

Section: Chapter Questions

Problem 18QAP: A four-liter tank is filled with propane gas, C3H8. The mass of the tank filled with gas is 1236 g....

See similar textbooks

Similar questions

perform stoichiometric ca1cu1uions for reactions involving gases as reactants or products.
Referring to exercises 1.6 and 1.7, does it matter if the pressure difference is caused by an ideal gas or a non-ideal gas? Explain your answer.
The compression ratio in an automobile engine is the ratio of the gas pressure at the end of the compression stroke to the pressure in the beginning. Assume that compression occurs at constant temperature. The total volume of the cylinder in an automobile is 350 cm3, and the displacement the reduction in volume during the compression stroke is 309 cm3. What is the compression ratio in that engine?
Under what conditions does the behavior of a real gas begin to differ significantly from the ideal gas law?
A four-liter tank is filled with propane gas, C3H8. The mass of the tank filled with gas is 1236 g. The pressure in the tank is 2.68 atm. The temperature in the room is 37C. The propane in the tank is used up under the same conditions of temperature and pressure. What is the mass of the empty tank?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
109 An ore sample with a mass of 670 kg contains 27.7% magnesium carbonate, MgCO3. If all of the magnesium carbonate in this ore sample is decomposed to form carbon dioxide, describe how to determine what volume of CO2 is evolved during the process. What would have to be measured to predict the needed volume in advance?
Can the speed of a given molecule in a gas double at constant temperature? Explain your answer.
Explain why the plot of PV for CO2 differs from that of an ideal gas.
2.50Lcontainer at 1.00atm and 48Cis filled with 5.41gof a monatomic gas. Determine the identity of the gas. Assuming the 2.50Lcontainer is a large elastic balloon, predict what will happen when 10.0gof oxygen gas is added to the balloon (which already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of balloon = ?L Now assuming the 2.50Lcontainer is rigid (like a steel container), predict what will happen when 10.0gof oxygen gas is added to the container (which again already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of rigid container = ? L
Methanol, CH3OH, is produced industrially by the following reaction: CO(g)+2H2(g)coppercatalyst300C,300atmCH3OH(g) Assuming that the gases behave as ideal gases, find the ratio of the total volume of the reactants to the final volume.