2. Draw the products and specify whether the equilibrium favors the reactants or products. In other words, is the base strong enough to thoroughly remove a proton from propyne? which side is favored? pKa ®оснз reactants or products? CH3он CH3C=CH NH3 CH3CH3 16 26 reactants or products? 35 50 ONH2 reactants or products? EH +°CH2CH3 °сн,сн,

2. Draw the products and specify whether the equilibrium favors the reactants or products. In other words, is the base strong enough to thoroughly remove a proton from propyne? which side is favored? pKa ®оснз reactants or products? CH3он CH3C=CH NH3 CH3CH3 16 26 reactants or products? 35 50 ONH2 reactants or products? EH +°CH2CH3 °сн,сн,

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter7: Alkynes

Section: Chapter Questions

Problem 7.10P: Complete each acid-base reaction and predict whether the position of equilibrium lies toward the...

See similar textbooks

Similar questions

left 4. Consider the following equilibrium: 29925610 + Aga weak and Sung base Bast CORS + 1ght base: Strong ad d AddOH ress stable OH Is the carboxylate anion (CH3CH₂COO) an appropriate base to deprotonate the alcohol? A) yes, because the equilibrium favors the left side B) yes, because the equilibrium favors the right side C) no, because the equilibrium favors the left side D) no, because the equilibrium favors the right side OH COO bas
What is the best reason why carboxylic acid 3 is the most acidic? aioH cioH а он дон CI- OH OH 1 || F ||| IV A) It is the least sterically hindered. B) The F groups are good leaving groups. C) F is very electronegative and can stabilize a negative charge as FO. D) F is very electronegative and will help to stabilize a negative charge on oxygen via induction. E) The conjugate base is stabilized by resonance.
Which of the following reactions are correct? Explain the answer. + H₂O + H₂O H₂SO4 H OH H OH
Rank the following compounds in order of decreasing acidity. Start with the most ackdic compound. CN OH HO OCHS CI C OCA»B OB>A>C OOB>A
For the following acid-base reaction, predict the position of the equilibrium and identify the most stable base. + NaOH || A. favor the right side with compound I being the most stable base B. favor the right side with compound II being the most stable base OC. favor the right side with compound III being the most stable base OD. favor the left side with compound I being the most stable base E. favor the left side with compound II being the most stable base سمیر ||| + H₂O IV
In each equilibrium, label the stronger acid, the stronger base, the weaker acid, and the weaker base. Also estimate the position of each equilibrium. (a) CH3CH2O + CH3CCH CH3CH2OH + CH3CC (b) CH3CH2O + HCl CH3CH2OH + Cl (c) CH3COOH + CH3CH2O CH3COO + CH3CH2OH
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
The key step in a reported laboratory synthesis of sativene, a hydrocarbon isolated from the mold Helminthosporium sativum, involves the following base treatment of a keto tosylate. What kind of reaction is occurring? How would you complete the synthesis?
5. sy For each reaction, identify the acid, base, conjugate acid, and conjugate base. Determine which direction the reaction will favor. Ka H₂SO3 = 1.54 x 10-2 and 1.07 x 10-7 Kb of CH3NH₂ = 4.4 x 10-4 Ka of CH3OH = 3.20 x 10-16 a. CH3O+ NH3 CH3OH + NH₂ b. HSO3 + CH3NH2 H₂SO3 + CH3NH3* c. 2HF + Ca(OH)2 2H₂O + CaF2
In each reaction, Label the reactants as a Lewis base (nucleophile) or a Lewis acid (electrophile). Use curved arrows to show the movement of electron pairs in the reaction. NH, H-C- H- H. ONH3
Which compound would be the weakest acid? O CH3CHCICHCICO2H O CHCI2CH2CH2CO2H CH3CCI2CH2CO2H O CICH2CHCICH2CO2H
In each reaction, label the reactants as Lewis acids (electrophiles) or Lewis bases (nucleophiles). Use curved arrows to show the movement of electron pairs in the reactions. Draw any nonbonding electrons to show how they participate in the reactions.(a) (CH3)2NH + HCl ¡ (CH3)2 NH+2 + Cl-(b) (CH3)2NH + CH3Cl ¡ (CH3)3 NH++ Cl-