18. When 1 mole of ethene in the gas state reacts with 1 mole of water in the gas state, 1 mole of ethanol in the gas state is produced in an equilibrium reaction. If an equilibrium mixture contains 0.020 M ethene and 0.015 M water, the equilibrium concentration of ethanol is 1.35 M. The equilibrium constant for this reaction is 9000. (True or False)

18. When 1 mole of ethene in the gas state reacts with 1 mole of water in the gas state, 1 mole of ethanol in the gas state is produced in an equilibrium reaction. If an equilibrium mixture contains 0.020 M ethene and 0.015 M water, the equilibrium concentration of ethanol is 1.35 M. The equilibrium constant for this reaction is 9000. (True or False)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 123CP: A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless,...

See similar textbooks

Similar questions

For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
For the system 2SO3(g)2SO2(g)+O2(g) K=1.32 at 627. What is the equilibrium constant at 555C?
Consider the decomposition equilibrium for dinitrogen pentoxide: 2N2O5(g)4NO2(g)+O2(g) At a certain temperature and a total pressure of 1.00 atm, the N2O5 is 0.50% decomposed (by moles) at equilibrium. a. If the volume is increased by a factor of 10.0. will the mole percent of N2O5 decomposed at equilibrium be greater than, less than. or equal to 0.50%? Explain your answer. b. Calculate the mole percent of N2O5 that will be decomposed at equilibrium if the volume is increased by a factor of 10.0.
At 2000 K, experiments show that the equilibrium constant for the formation of water is 1.6 1010. 2H2(g) + O2(g) 2H2O(g) Calculate the equilibrium constant at the same temperature for H2(g)+12O2(g) H2O(g)
For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?
7-64 As we shall see in Chapter 20, there are two forms of glucose, designated alpha and betawhich are in equilibrium in aqueous solution. The equilibrium constant for the reaction is 1.5 at 30°C. (a) If you begin with a fresh 1.0 M solution of D-glucose in water, what will be its concentration when equilibrium is reached? (b) Calculate the percentage of glucose and of glucose present at equilibrium in aqueous solution at 30°C.
5.16. In atmospheric chemistry, the following chemical reaction converts , the predominant oxide of sulfur that comes from combustion of S-containing materials, to , which can combine with to make sulfuric acid (and thus contribute to acid rain): (a) Write the expression for K for this equilibrium. (b) Calculate the value of for this equilibrium using the values in Appendix 2. (c) Calculate the value of K for this equilibrium. (d) If of and of are enclosed in a system in the presence of some liquid, in which direction would the reaction move?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
For the following system, K=4.86105 at 298K: HClO(aq)+F(aq)ClO(aq)+HF(aq) Assuming that you start with equal concentrations of HClO and F, and that no ClO or HF is initially present, which of the following best describes the equilibrium system: a the forward reaction is favored at equilibrium; b the reverse reaction is favored at equilibrium; c appreciable quantities of all species are present at equilibrium?